|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHFCl2 (fluorodichloromethane)
1A' CS
1910171554
InChI=1S/CHCl2F/c2-1(3)4/h1H INChIKey=UMNKXPULIDJLSU-UHFFFAOYSA-N
B3LYP/3-21G
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.1797 |
0.5858 |
0.0000 |
|
-0.2803 |
0.5144 |
-0.1797 |
| H2 |
-1.1143 |
1.1334 |
0.0000 |
|
-0.5423 |
0.9952 |
-1.1143 |
| F3 |
0.9226 |
1.3835 |
0.0000 |
|
-0.6620 |
1.2148 |
0.9226 |
| Cl4 |
-0.1797 |
-0.5029 |
1.5347 |
|
1.5883 |
0.2928 |
-0.1797 |
| Cl5 |
-0.1797 |
-0.5029 |
-1.5347 |
|
-1.1070 |
-1.1760 |
-0.1797 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
F3 |
Cl4 |
Cl5 |
| C1 |
|
1.0832 |
1.3607 |
1.8816 |
1.8816 |
| H2 |
1.0832 |
| 2.0522 |
2.4303 |
2.4303 |
| F3 |
1.3607 |
2.0522 |
| 2.6700 |
2.6700 |
| Cl4 |
1.8816 |
2.4303 |
2.6700 |
| 3.0694 |
| Cl5 |
1.8816 |
2.4303 |
2.6700 |
3.0694 |
|
Maximum atom distance is 3.0694Å
between atoms Cl4 and Cl5.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
F3 |
C1 |
Cl4 |
109.828 |
|
F3 |
C1 |
Cl5 |
109.828 |
|
Cl4 |
C1 |
Cl5 |
109.298 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
F3 |
113.740 |
|
H2 |
C1 |
Cl4 |
107.008 |
|
H2 |
C1 |
Cl5 |
107.008 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.