|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3NO3 (Methyl nitrate)
1A' CS
1910171554
InChI=1S/CH3NO3/c1-5-2(3)4/h1H3 INChIKey=LRMHVVPPGGOAJQ-UHFFFAOYSA-N
PBEPBE/3-21G
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| N1 |
0.0000 |
0.6546 |
0.0000 |
|
0.6524 |
0.0535 |
0.0000 |
| O2 |
-1.2669 |
0.5354 |
0.0000 |
|
0.6371 |
-1.2190 |
0.0000 |
| O3 |
0.7508 |
1.6659 |
0.0000 |
|
1.5991 |
0.8844 |
0.0000 |
| O4 |
0.7919 |
-0.6626 |
0.0000 |
|
-0.7251 |
0.7352 |
0.0000 |
| C5 |
-0.1768 |
-1.7816 |
0.0000 |
|
-1.7612 |
-0.3217 |
0.0000 |
| H6 |
0.4789 |
-2.6661 |
0.0000 |
|
-2.6963 |
0.2596 |
0.0000 |
| H7 |
-0.8124 |
-1.7683 |
0.8994 |
|
-1.6960 |
-0.9541 |
0.8994 |
| H8 |
-0.8124 |
-1.7683 |
-0.8994 |
|
-1.6960 |
-0.9541 |
-0.8994 |
Atom - Atom Distances (Å)
| |
N1 |
O2 |
O3 |
O4 |
C5 |
H6 |
H7 |
H8 |
| N1 |
|
1.2725 |
1.2596 |
1.5370 |
2.4426 |
3.3551 |
2.7091 |
2.7091 |
| O2 |
1.2725 |
| 2.3129 |
2.3821 |
2.5606 |
3.6466 |
2.5145 |
2.5145 |
| O3 |
1.2596 |
2.3129 |
| 2.3289 |
3.5702 |
4.3406 |
3.8790 |
3.8790 |
| O4 |
1.5370 |
2.3821 |
2.3289 |
|
1.4801 |
2.0278 |
2.1460 |
2.1460 |
| C5 |
2.4426 |
2.5606 |
3.5702 |
1.4801 |
|
1.1011 |
1.1014 |
1.1014 |
| H6 |
3.3551 |
3.6466 |
4.3406 |
2.0278 |
1.1011 |
| 1.8118 |
1.8118 |
| H7 |
2.7091 |
2.5145 |
3.8790 |
2.1460 |
1.1014 |
1.8118 |
| 1.7988 |
| H8 |
2.7091 |
2.5145 |
3.8790 |
2.1460 |
1.1014 |
1.8118 |
1.7988 |
|
Maximum atom distance is 4.3406Å
between atoms O3 and H6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
N1 |
O4 |
C5 |
108.101 |
|
O2 |
N1 |
O3 |
131.966 |
|
O2 |
N1 |
O4 |
115.640 |
|
O3 |
N1 |
O4 |
112.393 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O4 |
C5 |
H6 |
102.564 |
|
O4 |
C5 |
H7 |
111.628 |
|
O4 |
C5 |
H8 |
111.628 |
|
H6 |
C5 |
H7 |
110.695 |
|
H6 |
C5 |
H8 |
110.695 |
|
H7 |
C5 |
H8 |
109.490 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.