|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHFCl2 (fluorodichloromethane)
1A' CS
1910171554
InChI=1S/CHCl2F/c2-1(3)4/h1H INChIKey=UMNKXPULIDJLSU-UHFFFAOYSA-N
B97D3/3-21G
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.1792 |
0.5929 |
0.0000 |
|
-0.2817 |
0.5217 |
-0.1792 |
| H2 |
-1.1244 |
1.1332 |
0.0000 |
|
-0.5384 |
0.9972 |
-1.1244 |
| F3 |
0.9212 |
1.4027 |
0.0000 |
|
-0.6664 |
1.2343 |
0.9212 |
| Cl4 |
-0.1792 |
-0.5093 |
1.5461 |
|
1.6024 |
0.2864 |
-0.1792 |
| Cl5 |
-0.1792 |
-0.5093 |
-1.5461 |
|
-1.1185 |
-1.1826 |
-0.1792 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
F3 |
Cl4 |
Cl5 |
| C1 |
|
1.0887 |
1.3662 |
1.8987 |
1.8987 |
| H2 |
1.0887 |
| 2.0632 |
2.4457 |
2.4457 |
| F3 |
1.3662 |
2.0632 |
| 2.6938 |
2.6938 |
| Cl4 |
1.8987 |
2.4457 |
2.6938 |
| 3.0921 |
| Cl5 |
1.8987 |
2.4457 |
2.6938 |
3.0921 |
|
Maximum atom distance is 3.0921Å
between atoms Cl4 and Cl5.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
F3 |
C1 |
Cl4 |
110.113 |
|
F3 |
C1 |
Cl5 |
110.113 |
|
Cl4 |
C1 |
Cl5 |
111.282 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
F3 |
111.173 |
|
H2 |
C1 |
Cl4 |
107.044 |
|
H2 |
C1 |
Cl5 |
107.044 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.