|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C3H6O (Acetone enol)
1A' CS
1910171554
InChI=1S/C3H6O/c1-3(2)4/h4H,1H2,2H3 INChIKey=NARVIWMVBMUEOG-UHFFFAOYSA-N
B2PLYP/STO-3G
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.8892 |
-1.1528 |
0.0000 |
|
-0.5908 |
1.3306 |
0.0000 |
| C2 |
0.0000 |
0.1025 |
0.0000 |
|
0.0902 |
-0.0488 |
0.0000 |
| C3 |
0.4678 |
1.3683 |
0.0000 |
|
1.4260 |
-0.2396 |
0.0000 |
| O4 |
-1.3696 |
-0.2459 |
0.0000 |
|
-0.8679 |
-1.0876 |
0.0000 |
| H5 |
1.9497 |
-0.8660 |
0.0000 |
|
0.1661 |
2.1268 |
0.0000 |
| H6 |
0.6858 |
-1.7683 |
0.8907 |
|
-1.2289 |
1.4446 |
0.8907 |
| H7 |
0.6858 |
-1.7683 |
-0.8907 |
|
-1.2289 |
1.4446 |
-0.8907 |
| H8 |
1.5390 |
1.5730 |
0.0000 |
|
2.1158 |
0.6051 |
0.0000 |
| H9 |
-0.2080 |
2.2279 |
0.0000 |
|
1.8606 |
-1.2431 |
0.0000 |
| H10 |
-1.8375 |
0.6607 |
0.0000 |
|
-0.2932 |
-1.9305 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
O4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
|
1.5384 |
2.5560 |
2.4341 |
1.0986 |
1.1016 |
1.1016 |
2.8022 |
3.5543 |
3.2747 |
| C2 |
1.5384 |
|
1.3494 |
1.4132 |
2.1770 |
2.1826 |
2.1826 |
2.1285 |
2.1355 |
1.9204 |
| C3 |
2.5560 |
1.3494 |
| 2.4457 |
2.6809 |
3.2678 |
3.2678 |
1.0905 |
1.0936 |
2.4115 |
| O4 |
2.4341 |
1.4132 |
2.4457 |
| 3.3767 |
2.7085 |
2.7085 |
3.4304 |
2.7329 |
1.0202 |
| H5 |
1.0986 |
2.1770 |
2.6809 |
3.3767 |
| 1.7902 |
1.7902 |
2.4733 |
3.7720 |
4.0833 |
| H6 |
1.1016 |
2.1826 |
3.2678 |
2.7085 |
1.7902 |
| 1.7814 |
3.5616 |
4.1907 |
3.6139 |
| H7 |
1.1016 |
2.1826 |
3.2678 |
2.7085 |
1.7902 |
1.7814 |
| 3.5616 |
4.1907 |
3.6139 |
| H8 |
2.8022 |
2.1285 |
1.0905 |
3.4304 |
2.4733 |
3.5616 |
3.5616 |
| 1.8657 |
3.4975 |
| H9 |
3.5543 |
2.1355 |
1.0936 |
2.7329 |
3.7720 |
4.1907 |
4.1907 |
1.8657 |
| 2.2608 |
| H10 |
3.2747 |
1.9204 |
2.4115 |
1.0202 |
4.0833 |
3.6139 |
3.6139 |
3.4975 |
2.2608 |
|
Maximum atom distance is 4.1907Å
between atoms H6 and H9.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C3 |
124.404 |
|
C1 |
C2 |
O4 |
111.037 |
|
C3 |
C2 |
O4 |
124.558 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
H5 |
110.174 |
|
C2 |
C1 |
H6 |
110.441 |
|
C2 |
C1 |
H7 |
110.441 |
|
C2 |
C3 |
H8 |
121.106 |
|
C2 |
C3 |
H9 |
121.540 |
|
C2 |
O4 |
H10 |
103.026 |
|
H5 |
C1 |
H6 |
108.909 |
|
H5 |
C1 |
H7 |
108.909 |
|
H6 |
C1 |
H7 |
107.910 |
|
H8 |
C3 |
H9 |
117.355 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.