|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHBrF2 (Methane, bromodifluoro-)
1A' CS
1910171554
InChI=1S/CHBrF2/c2-1(3)4/h1H INChIKey=GRCDJFHYVYUNHM-UHFFFAOYSA-N
B1B95/STO-3G
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.4222 |
-0.9300 |
0.0000 |
|
0.0194 |
-0.4218 |
-0.9300 |
| H2 |
-1.5504 |
-0.9690 |
0.0000 |
|
0.0713 |
-1.5488 |
-0.9690 |
| Br3 |
0.0771 |
0.9906 |
0.0000 |
|
-0.0035 |
0.0770 |
0.9906 |
| F4 |
0.0771 |
-1.5623 |
1.1240 |
|
1.1192 |
0.1287 |
-1.5623 |
| F5 |
0.0771 |
-1.5623 |
-1.1240 |
|
-1.1263 |
0.0253 |
-1.5623 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
Br3 |
F4 |
F5 |
| C1 |
|
1.1289 |
1.9844 |
1.3829 |
1.3829 |
| H2 |
1.1289 |
| 2.5473 |
2.0650 |
2.0650 |
| Br3 |
1.9844 |
2.5473 |
| 2.7894 |
2.7894 |
| F4 |
1.3829 |
2.0650 |
2.7894 |
| 2.2479 |
| F5 |
1.3829 |
2.0650 |
2.7894 |
2.2479 |
|
Maximum atom distance is 2.7894Å
between atoms Br3 and F4.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
Br3 |
C1 |
F4 |
110.591 |
|
Br3 |
C1 |
F5 |
110.591 |
|
F4 |
C1 |
F5 |
108.733 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
Br3 |
106.552 |
|
H2 |
C1 |
F4 |
110.184 |
|
H2 |
C1 |
F5 |
110.184 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.