|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHF3 (Methane, trifluoro-)
1A1 C3V
1910171554
InChI=1S/CHF3/c2-1(3)4/h1H INChIKey=XPDWGBQVDMORPB-UHFFFAOYSA-N
MP2/STO-3G
Point group is C3v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.3481 |
|
0.0000 |
0.0000 |
0.3481 |
| H2 |
0.0000 |
0.0000 |
1.4857 |
|
0.0000 |
0.0000 |
1.4857 |
| F3 |
0.0000 |
1.3043 |
-0.1324 |
|
1.1013 |
0.6989 |
-0.1324 |
| F4 |
1.1296 |
-0.6522 |
-0.1324 |
|
-1.1559 |
0.6043 |
-0.1324 |
| F5 |
-1.1296 |
-0.6522 |
-0.1324 |
|
0.0546 |
-1.3032 |
-0.1324 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
F3 |
F4 |
F5 |
| C1 |
|
1.1376 |
1.3900 |
1.3900 |
1.3900 |
| H2 |
1.1376 |
| 2.0783 |
2.0783 |
2.0783 |
| F3 |
1.3900 |
2.0783 |
| 2.2592 |
2.2592 |
| F4 |
1.3900 |
2.0783 |
2.2592 |
| 2.2592 |
| F5 |
1.3900 |
2.0783 |
2.2592 |
2.2592 |
|
Maximum atom distance is 2.2592Å
between atoms F4 and F5.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
F3 |
C1 |
F4 |
108.712 |
|
F3 |
C1 |
F5 |
108.712 |
|
F4 |
C1 |
F5 |
108.712 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
F3 |
110.220 |
|
H2 |
C1 |
F4 |
110.220 |
|
H2 |
C1 |
F5 |
110.220 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.