|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH2CF2 (Ethene, 1,1-difluoro-)
1A1 C2V
1910171554
InChI=1S/C2H2F2/c1-2(3)4/h1H2 INChIKey=BQCIDUSAKPWEOX-UHFFFAOYSA-N
mPW1PW91/6-311G**
Point group is C2v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
1.3792 |
|
1.3792 |
0.0000 |
0.0000 |
| C2 |
0.0000 |
0.0000 |
0.0639 |
|
0.0639 |
0.0000 |
0.0000 |
| H3 |
0.0000 |
0.9366 |
1.9129 |
|
1.9129 |
0.9366 |
0.0000 |
| H4 |
0.0000 |
-0.9366 |
1.9129 |
|
1.9129 |
-0.9366 |
0.0000 |
| F5 |
0.0000 |
1.0756 |
-0.6936 |
|
-0.6936 |
1.0756 |
0.0000 |
| F6 |
0.0000 |
-1.0756 |
-0.6936 |
|
-0.6936 |
-1.0756 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
H3 |
H4 |
F5 |
F6 |
| C1 |
|
1.3152 |
1.0780 |
1.0780 |
2.3352 |
2.3352 |
| C2 |
1.3152 |
| 2.0727 |
2.0727 |
1.3156 |
1.3156 |
| H3 |
1.0780 |
2.0727 |
| 1.8732 |
2.6102 |
3.2929 |
| H4 |
1.0780 |
2.0727 |
1.8732 |
| 3.2929 |
2.6102 |
| F5 |
2.3352 |
1.3156 |
2.6102 |
3.2929 |
| 2.1513 |
| F6 |
2.3352 |
1.3156 |
3.2929 |
2.6102 |
2.1513 |
|
Maximum atom distance is 3.2929Å
between atoms H3 and F6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
F5 |
125.156 |
|
C1 |
C2 |
F6 |
125.156 |
|
F5 |
C2 |
F6 |
109.688 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
H3 |
119.680 |
|
C2 |
C1 |
H4 |
119.680 |
|
H3 |
C1 |
H4 |
120.641 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.