|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for HN=C=C(CN)2 (Dicyanoketenimine)
1A' CS
1910171554
InChI=1S/C4HN3/c5-1-4(2-6)3-7/h5H INChIKey=
CCSD(T)/6-311G**
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.0081 |
-0.0544 |
0.0000 |
|
0.0009 |
-0.0544 |
-0.0081 |
| C2 |
-0.0081 |
1.2901 |
0.0000 |
|
-0.0213 |
1.2899 |
-0.0081 |
| N3 |
0.1421 |
2.4984 |
0.0000 |
|
-0.0412 |
2.4980 |
0.1421 |
| C4 |
-0.0081 |
-0.7664 |
1.2512 |
|
1.2636 |
-0.7456 |
-0.0081 |
| C5 |
-0.0081 |
-0.7664 |
-1.2512 |
|
-1.2383 |
-0.7869 |
-0.0081 |
| N6 |
-0.0081 |
-1.3429 |
2.2681 |
|
2.2899 |
-1.3053 |
-0.0081 |
| N7 |
-0.0081 |
-1.3429 |
-2.2681 |
|
-2.2456 |
-1.3801 |
-0.0081 |
| H8 |
-0.6872 |
3.0944 |
0.0000 |
|
-0.0510 |
3.0940 |
-0.6872 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
N3 |
C4 |
C5 |
N6 |
N7 |
H8 |
| C1 |
|
1.3445 |
2.5572 |
1.4395 |
1.4395 |
2.6085 |
2.6085 |
3.2212 |
| C2 |
1.3445 |
|
1.2176 |
2.4072 |
2.4072 |
3.4752 |
3.4752 |
1.9279 |
| N3 |
2.5572 |
1.2176 |
| 3.4995 |
3.4995 |
4.4634 |
4.4634 |
1.0212 |
| C4 |
1.4395 |
2.4072 |
3.4995 |
| 2.5023 |
1.1690 |
3.5661 |
4.1149 |
| C5 |
1.4395 |
2.4072 |
3.4995 |
2.5023 |
| 3.5661 |
1.1690 |
4.1149 |
| N6 |
2.6085 |
3.4752 |
4.4634 |
1.1690 |
3.5661 |
| 4.5361 |
5.0294 |
| N7 |
2.6085 |
3.4752 |
4.4634 |
3.5661 |
1.1690 |
4.5361 |
| 5.0294 |
| H8 |
3.2212 |
1.9279 |
1.0212 |
4.1149 |
4.1149 |
5.0294 |
5.0294 |
|
Maximum atom distance is 5.0294Å
between atoms N6 and H8.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
N3 |
172.917 |
|
C1 |
C4 |
N6 |
179.908 |
|
C1 |
C5 |
N7 |
179.908 |
|
C2 |
C1 |
C4 |
119.642 |
|
C2 |
C1 |
C5 |
119.642 |
|
C4 |
C1 |
C5 |
120.716 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
N3 |
H8 |
118.621 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.