|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COCl (Acetyl Chloride)
1A' CS
1910171554
InChI=1S/C2H3ClO/c1-2(3)4/h1H3 INChIKey=WETWJCDKMRHUPV-UHFFFAOYSA-N
mPW1PW91/6-311G**
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.5389 |
0.0000 |
|
0.5026 |
0.1947 |
0.0000 |
| C2 |
1.4814 |
0.7241 |
0.0000 |
|
0.1402 |
1.6429 |
0.0000 |
| O3 |
-0.8401 |
1.3626 |
0.0000 |
|
1.5740 |
-0.2912 |
0.0000 |
| Cl4 |
-0.4525 |
-1.2206 |
0.0000 |
|
-0.9748 |
-0.8629 |
0.0000 |
| H5 |
1.7077 |
1.7886 |
0.0000 |
|
1.0511 |
2.2385 |
0.0000 |
| H6 |
1.9090 |
0.2417 |
0.8796 |
|
-0.4641 |
1.8675 |
0.8796 |
| H7 |
1.9090 |
0.2417 |
-0.8796 |
|
-0.4641 |
1.8675 |
-0.8796 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
O3 |
Cl4 |
H5 |
H6 |
H7 |
| C1 |
|
1.4929 |
1.1765 |
1.8169 |
2.1161 |
2.1229 |
2.1229 |
| C2 |
1.4929 |
| 2.4076 |
2.7426 |
1.0883 |
1.0906 |
1.0906 |
| O3 |
1.1765 |
2.4076 |
| 2.6121 |
2.5832 |
3.0964 |
3.0964 |
| Cl4 |
1.8169 |
2.7426 |
2.6121 |
| 3.7044 |
2.9136 |
2.9136 |
| H5 |
2.1161 |
1.0883 |
2.5832 |
3.7044 |
| 1.7909 |
1.7909 |
| H6 |
2.1229 |
1.0906 |
3.0964 |
2.9136 |
1.7909 |
| 1.7593 |
| H7 |
2.1229 |
1.0906 |
3.0964 |
2.9136 |
1.7909 |
1.7593 |
|
Maximum atom distance is 3.7044Å
between atoms Cl4 and H5.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
O3 |
128.443 |
|
C2 |
C1 |
Cl4 |
111.548 |
|
O3 |
C1 |
Cl4 |
120.010 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H5 |
109.130 |
|
C1 |
C2 |
H6 |
109.528 |
|
C1 |
C2 |
H7 |
109.528 |
|
H5 |
C2 |
H6 |
110.554 |
|
H5 |
C2 |
H7 |
110.554 |
|
H6 |
C2 |
H7 |
107.524 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.