|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C3H8O2 (Propylene glycol)
1A C1
1910171554
InChI=1S/C3H8O2/c1-3(5)2-4/h3-5H,2H2,1H3 INChIKey=DNIAPMSPPWPWGF-UHFFFAOYSA-N
wB97X-D/6-311G**
Point group is C1
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| O1 |
-0.4116 |
1.3730 |
-0.1584 |
|
0.3655 |
1.3881 |
-0.1388 |
| H2 |
0.5214 |
1.6104 |
-0.1631 |
|
-0.5750 |
1.5934 |
-0.1492 |
| O3 |
1.9334 |
-0.0543 |
-0.0029 |
|
-1.9302 |
-0.1206 |
-0.0213 |
| H4 |
2.1334 |
-0.1095 |
0.9333 |
|
-2.1365 |
-0.1936 |
0.9123 |
| C5 |
0.7070 |
-0.7455 |
-0.2248 |
|
-0.6789 |
-0.7666 |
-0.2399 |
| H6 |
0.6043 |
-0.8199 |
-1.3098 |
|
-0.5642 |
-0.8245 |
-1.3247 |
| H7 |
0.7376 |
-1.7581 |
0.1962 |
|
-0.6784 |
-1.7845 |
0.1691 |
| C8 |
-0.4621 |
0.0499 |
0.3404 |
|
0.4571 |
0.0617 |
0.3452 |
| H9 |
-0.3609 |
0.0705 |
1.4398 |
|
0.3456 |
0.0657 |
1.4438 |
| C10 |
-1.8065 |
-0.5489 |
-0.0242 |
|
1.8245 |
-0.4863 |
-0.0140 |
| H11 |
-1.9131 |
-0.5971 |
-1.1109 |
|
1.9422 |
-0.5179 |
-1.1001 |
| H12 |
-1.9168 |
-1.5552 |
0.3894 |
|
1.9657 |
-1.4931 |
0.3890 |
| H13 |
-2.6101 |
0.0763 |
0.3681 |
|
2.6026 |
0.1614 |
0.3929 |
Atom - Atom Distances (Å)
| |
O1 |
H2 |
O3 |
H4 |
C5 |
H6 |
H7 |
C8 |
H9 |
C10 |
H11 |
H12 |
H13 |
| O1 |
|
0.9628 |
2.7497 |
3.1412 |
2.3966 |
2.6771 |
3.3542 |
1.4149 |
2.0624 |
2.3786 |
2.6539 |
3.3377 |
2.6061 |
| H2 |
0.9628 |
| 2.1888 |
2.5997 |
2.3640 |
2.6886 |
3.3945 |
1.9121 |
2.3914 |
3.1783 |
3.4203 |
4.0338 |
3.5273 |
| O3 |
2.7497 |
2.1888 |
|
0.9589 |
1.4251 |
2.0151 |
2.0910 |
2.4221 |
2.7130 |
3.7725 |
4.0395 |
4.1509 |
4.5604 |
| H4 |
3.1412 |
2.5997 |
0.9589 |
| 1.9444 |
2.8061 |
2.2824 |
2.6671 |
2.5516 |
4.0784 |
4.5597 |
4.3348 |
4.7807 |
| C5 |
2.3966 |
2.3640 |
1.4251 |
1.9444 |
|
1.0924 |
1.0971 |
1.5227 |
2.1394 |
2.5291 |
2.7698 |
2.8137 |
3.4684 |
| H6 |
2.6771 |
2.6886 |
2.0151 |
2.8061 |
1.0924 |
| 1.7793 |
2.1487 |
3.0471 |
2.7456 |
2.5351 |
3.1279 |
3.7350 |
| H7 |
3.3542 |
3.3945 |
2.0910 |
2.2824 |
1.0971 |
1.7793 |
| 2.1746 |
2.4692 |
2.8255 |
3.1753 |
2.6691 |
3.8212 |
| C8 |
1.4149 |
1.9121 |
2.4221 |
2.6671 |
1.5227 |
2.1487 |
2.1746 |
|
1.1043 |
1.5163 |
2.1519 |
2.1668 |
2.1484 |
| H9 |
2.0624 |
2.3914 |
2.7130 |
2.5516 |
2.1394 |
3.0471 |
2.4692 |
1.1043 |
| 2.1487 |
3.0596 |
2.4833 |
2.4915 |
| C10 |
2.3786 |
3.1783 |
3.7725 |
4.0784 |
2.5291 |
2.7456 |
2.8255 |
1.5163 |
2.1487 |
|
1.0930 |
1.0936 |
1.0911 |
| H11 |
2.6539 |
3.4203 |
4.0395 |
4.5597 |
2.7698 |
2.5351 |
3.1753 |
2.1519 |
3.0596 |
1.0930 |
| 1.7802 |
1.7682 |
| H12 |
3.3377 |
4.0338 |
4.1509 |
4.3348 |
2.8137 |
3.1279 |
2.6691 |
2.1668 |
2.4833 |
1.0936 |
1.7802 |
| 1.7728 |
| H13 |
2.6061 |
3.5273 |
4.5604 |
4.7807 |
3.4684 |
3.7350 |
3.8212 |
2.1484 |
2.4915 |
1.0911 |
1.7682 |
1.7728 |
|
Maximum atom distance is 4.7807Å
between atoms H4 and H13.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O1 |
C8 |
C5 |
109.282 |
|
O1 |
C8 |
C10 |
108.427 |
|
O3 |
C5 |
C8 |
110.460 |
|
C5 |
C8 |
C10 |
112.655 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O1 |
C8 |
H9 |
109.285 |
|
H2 |
O1 |
C8 |
105.474 |
|
O3 |
C5 |
H6 |
105.582 |
|
O3 |
C5 |
H7 |
111.335 |
|
H4 |
O3 |
C5 |
107.681 |
|
C5 |
C8 |
H9 |
107.998 |
|
H6 |
C5 |
H7 |
108.717 |
|
H6 |
C5 |
C8 |
109.399 |
|
H7 |
C5 |
C8 |
111.167 |
|
C8 |
C10 |
H11 |
110.060 |
|
C8 |
C10 |
H12 |
111.212 |
|
C8 |
C10 |
H13 |
109.891 |
|
H9 |
C8 |
C10 |
109.150 |
|
H11 |
C10 |
H12 |
109.007 |
|
H11 |
C10 |
H13 |
108.115 |
|
H12 |
C10 |
H13 |
108.483 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.