|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CHBrCH3 (i-propyl bromide)
1A' CS
1910171554
InChI=1S/C3H7Br/c1-3(2)4/h3H,1-2H3 INChIKey=NAMYKGVDVNBCFQ-UHFFFAOYSA-N
mPW1PW91/6-311G**
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.9086 |
-0.4382 |
0.0000 |
|
-0.5657 |
-0.7110 |
-0.4382 |
| Br2 |
-0.6742 |
0.7554 |
0.0000 |
|
0.4198 |
0.5276 |
0.7554 |
| H3 |
1.7404 |
0.2651 |
0.0000 |
|
-1.0836 |
-1.3619 |
0.2651 |
| C4 |
0.9086 |
-1.2652 |
1.2672 |
|
0.4259 |
-1.5000 |
-1.2652 |
| C5 |
0.9086 |
-1.2652 |
-1.2672 |
|
-1.5573 |
0.0780 |
-1.2652 |
| H6 |
0.0386 |
-1.9234 |
1.3033 |
|
0.9959 |
-0.8417 |
-1.9234 |
| H7 |
1.8092 |
-1.8870 |
1.2900 |
|
-0.1170 |
-2.2190 |
-1.8870 |
| H8 |
0.9037 |
-0.6361 |
2.1571 |
|
1.1253 |
-2.0502 |
-0.6361 |
| H9 |
0.0386 |
-1.9234 |
-1.3033 |
|
-1.0439 |
0.7813 |
-1.9234 |
| H10 |
1.8092 |
-1.8870 |
-1.2900 |
|
-2.1359 |
-0.6126 |
-1.8870 |
| H11 |
0.9037 |
-0.6361 |
-2.1571 |
|
-2.2506 |
0.6358 |
-0.6361 |
Atom - Atom Distances (Å)
| |
C1 |
Br2 |
H3 |
C4 |
C5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
| C1 |
| 1.9824 |
1.0893 |
1.5132 |
1.5132 |
2.1590 |
2.1388 |
2.1661 |
2.1590 |
2.1388 |
2.1661 |
| Br2 |
1.9824 |
| 2.4639 |
2.8625 |
2.8625 |
3.0631 |
3.8489 |
3.0132 |
3.0631 |
3.8489 |
3.0132 |
| H3 |
1.0893 |
2.4639 |
| 2.1540 |
2.1540 |
3.0634 |
2.5100 |
2.4830 |
3.0634 |
2.5100 |
2.4830 |
| C4 |
1.5132 |
2.8625 |
2.1540 |
| 2.5344 |
1.0915 |
1.0947 |
1.0898 |
2.7924 |
2.7816 |
3.4816 |
| C5 |
1.5132 |
2.8625 |
2.1540 |
2.5344 |
| 2.7924 |
2.7816 |
3.4816 |
1.0915 |
1.0947 |
1.0898 |
| H6 |
2.1590 |
3.0631 |
3.0634 |
1.0915 |
2.7924 |
| 1.7711 |
1.7704 |
2.6067 |
3.1404 |
3.7921 |
| H7 |
2.1388 |
3.8489 |
2.5100 |
1.0947 |
2.7816 |
1.7711 |
| 1.7710 |
3.1404 |
2.5800 |
3.7772 |
| H8 |
2.1661 |
3.0132 |
2.4830 |
1.0898 |
3.4816 |
1.7704 |
1.7710 |
| 3.7921 |
3.7772 |
4.3141 |
| H9 |
2.1590 |
3.0631 |
3.0634 |
2.7924 |
1.0915 |
2.6067 |
3.1404 |
3.7921 |
| 1.7711 |
1.7704 |
| H10 |
2.1388 |
3.8489 |
2.5100 |
2.7816 |
1.0947 |
3.1404 |
2.5800 |
3.7772 |
1.7711 |
| 1.7710 |
| H11 |
2.1661 |
3.0132 |
2.4830 |
3.4816 |
1.0898 |
3.7921 |
3.7772 |
4.3141 |
1.7704 |
1.7710 |
|
Maximum atom distance is 4.3141Å
between atoms H8 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
Br2 |
C1 |
C4 |
109.213 |
|
Br2 |
C1 |
C5 |
109.213 |
|
C4 |
C1 |
C5 |
113.743 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C4 |
H6 |
110.932 |
|
C1 |
C4 |
H7 |
109.139 |
|
C1 |
C4 |
H8 |
111.611 |
|
C1 |
C5 |
H9 |
110.932 |
|
C1 |
C5 |
H10 |
109.139 |
|
C1 |
C5 |
H11 |
111.611 |
|
Br2 |
C1 |
H3 |
102.765 |
|
H3 |
C1 |
C4 |
110.661 |
|
H3 |
C1 |
C5 |
110.661 |
|
H6 |
C4 |
H7 |
108.219 |
|
H6 |
C4 |
H8 |
108.514 |
|
H7 |
C4 |
H8 |
108.331 |
|
H9 |
C5 |
H10 |
108.219 |
|
H9 |
C5 |
H11 |
108.514 |
|
H10 |
C5 |
H11 |
108.331 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.