|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHBrCl2 (Methane, bromodichloro-)
1A' CS
1910171554
InChI=1S/CHBrCl2/c2-1(3)4/h1H INChIKey=FMWLUWPQPKEARP-UHFFFAOYSA-N
MP2=FULL/6-311G**
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.6633 |
-0.1475 |
0.0000 |
|
0.3583 |
-0.5582 |
-0.1475 |
| H2 |
-1.5714 |
0.4442 |
0.0000 |
|
0.8487 |
-1.3225 |
0.4442 |
| Br3 |
0.8030 |
1.1165 |
0.0000 |
|
-0.4337 |
0.6758 |
1.1165 |
| Cl4 |
-0.6633 |
-1.1364 |
1.4576 |
|
1.5849 |
0.2290 |
-1.1364 |
| Cl5 |
-0.6633 |
-1.1364 |
-1.4576 |
|
-0.8684 |
-1.3455 |
-1.1364 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
Br3 |
Cl4 |
Cl5 |
| C1 |
|
1.0839 |
1.9359 |
1.7614 |
1.7614 |
| H2 |
1.0839 |
| 2.4677 |
2.3340 |
2.3340 |
| Br3 |
1.9359 |
2.4677 |
| 3.0578 |
3.0578 |
| Cl4 |
1.7614 |
2.3340 |
3.0578 |
| 2.9152 |
| Cl5 |
1.7614 |
2.3340 |
3.0578 |
2.9152 |
|
Maximum atom distance is 3.0578Å
between atoms Br3 and Cl4.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
Br3 |
C1 |
Cl4 |
111.504 |
|
Br3 |
C1 |
Cl5 |
111.504 |
|
Cl4 |
C1 |
Cl5 |
111.693 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
Br3 |
106.145 |
|
H2 |
C1 |
Cl4 |
107.849 |
|
H2 |
C1 |
Cl5 |
107.849 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.