|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CHOHCH3 (Isopropyl alcohol)
1A C1
1910171554
InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3 INChIKey=KFZMGEQAYNKOFK-UHFFFAOYSA-N
HF/6-311G**
Point group is C1
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0022 |
0.0467 |
0.3595 |
|
0.0076 |
0.0382 |
0.3605 |
| C2 |
-1.1923 |
-0.7799 |
-0.1008 |
|
-1.2757 |
-0.6319 |
-0.1147 |
| C3 |
1.3272 |
-0.5442 |
-0.0873 |
|
1.2540 |
-0.6944 |
-0.1025 |
| O4 |
-0.0564 |
1.3521 |
-0.1670 |
|
0.1029 |
1.3527 |
-0.1373 |
| H5 |
-0.0065 |
0.0979 |
1.4488 |
|
0.0050 |
0.0662 |
1.4506 |
| H6 |
-2.1258 |
-0.3267 |
0.2260 |
|
-2.1495 |
-0.0794 |
0.2242 |
| H7 |
-1.2103 |
-0.8452 |
-1.1845 |
|
-1.3012 |
-0.6709 |
-1.1996 |
| H8 |
-1.1522 |
-1.7854 |
0.3082 |
|
-1.3541 |
-1.6439 |
0.2721 |
| H9 |
2.1473 |
0.0791 |
0.2516 |
|
2.1417 |
-0.1794 |
0.2479 |
| H10 |
1.4607 |
-1.5436 |
0.3161 |
|
1.2691 |
-1.7112 |
0.2787 |
| H11 |
1.3672 |
-0.5981 |
-1.1710 |
|
1.2875 |
-0.7289 |
-1.1872 |
| H12 |
-0.8514 |
1.7695 |
0.1118 |
|
-0.6375 |
1.8545 |
0.1525 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
O4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
H12 |
| C1 |
|
1.5238 |
1.5181 |
1.4088 |
1.0905 |
2.1646 |
2.1563 |
2.1660 |
2.1481 |
2.1583 |
2.1499 |
1.9386 |
| C2 |
1.5238 |
| 2.5306 |
2.4166 |
2.1396 |
1.0879 |
1.0859 |
1.0863 |
3.4663 |
2.7921 |
2.7803 |
2.5809 |
| C3 |
1.5181 |
2.5306 |
| 2.3488 |
2.1332 |
3.4740 |
2.7809 |
2.8008 |
1.0844 |
1.0860 |
1.0858 |
3.1843 |
| O4 |
1.4088 |
2.4166 |
2.3488 |
| 2.0461 |
2.6935 |
2.6823 |
3.3572 |
2.5792 |
3.3046 |
2.6150 |
0.9402 |
| H5 |
1.0905 |
2.1396 |
2.1332 |
2.0461 |
| 2.4833 |
3.0451 |
2.4820 |
2.4642 |
2.4759 |
3.0389 |
2.3013 |
| H6 |
2.1646 |
1.0879 |
3.4740 |
2.6935 |
2.4833 |
| 1.7597 |
1.7557 |
4.2924 |
3.7884 |
3.7718 |
2.4559 |
| H7 |
2.1563 |
1.0859 |
2.7809 |
2.6823 |
3.0451 |
1.7597 |
| 1.7651 |
3.7670 |
3.1423 |
2.5894 |
2.9404 |
| H8 |
2.1660 |
1.0863 |
2.8008 |
3.3572 |
2.4820 |
1.7557 |
1.7651 |
| 3.7903 |
2.6241 |
3.1536 |
3.5730 |
| H9 |
2.1481 |
3.4663 |
1.0844 |
2.5792 |
2.4642 |
4.2924 |
3.7670 |
3.7903 |
| 1.7632 |
1.7581 |
3.4453 |
| H10 |
2.1583 |
2.7921 |
1.0860 |
3.3046 |
2.4759 |
3.7884 |
3.1423 |
2.6241 |
1.7632 |
| 1.7647 |
4.0454 |
| H11 |
2.1499 |
2.7803 |
1.0858 |
2.6150 |
3.0389 |
3.7718 |
2.5894 |
3.1536 |
1.7581 |
1.7647 |
| 3.4891 |
| H12 |
1.9386 |
2.5809 |
3.1843 |
0.9402 |
2.3013 |
2.4559 |
2.9404 |
3.5730 |
3.4453 |
4.0454 |
3.4891 |
|
Maximum atom distance is 4.2924Å
between atoms H6 and H9.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
C3 |
112.594 |
|
C2 |
C1 |
O4 |
110.924 |
|
C3 |
C1 |
O4 |
106.676 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H6 |
110.852 |
|
C1 |
C2 |
H7 |
110.311 |
|
C1 |
C2 |
H8 |
111.066 |
|
C1 |
C3 |
H9 |
110.146 |
|
C1 |
C3 |
H10 |
110.864 |
|
C1 |
C3 |
H11 |
110.198 |
|
C1 |
O4 |
H12 |
109.618 |
|
C2 |
C1 |
H5 |
108.724 |
|
C3 |
C1 |
H5 |
108.613 |
|
O4 |
C1 |
H5 |
109.236 |
|
H6 |
C2 |
H7 |
108.098 |
|
H6 |
C2 |
H8 |
107.710 |
|
H7 |
C2 |
H8 |
108.702 |
|
H9 |
C3 |
H10 |
108.660 |
|
H9 |
C3 |
H11 |
108.216 |
|
H10 |
C3 |
H11 |
108.690 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.