|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C3H6O (Acetone enol)
1A' CS
1910171554
InChI=1S/C3H6O/c1-3(2)4/h4H,1H2,2H3 INChIKey=NARVIWMVBMUEOG-UHFFFAOYSA-N
BLYP/6-311G**
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.9371 |
-1.0805 |
0.0000 |
|
-0.3572 |
1.3849 |
0.0000 |
| C2 |
0.0000 |
0.1000 |
0.0000 |
|
0.0823 |
-0.0568 |
0.0000 |
| C3 |
0.3728 |
1.3932 |
0.0000 |
|
1.3584 |
-0.4844 |
0.0000 |
| O4 |
-1.3165 |
-0.3292 |
0.0000 |
|
-1.0187 |
-0.8967 |
0.0000 |
| H5 |
1.9834 |
-0.7545 |
0.0000 |
|
0.5054 |
2.0610 |
0.0000 |
| H6 |
0.7584 |
-1.7092 |
0.8857 |
|
-0.9761 |
1.5949 |
0.8857 |
| H7 |
0.7584 |
-1.7092 |
-0.8857 |
|
-0.9761 |
1.5949 |
-0.8857 |
| H8 |
1.4240 |
1.6695 |
0.0000 |
|
2.1828 |
0.2240 |
0.0000 |
| H9 |
-0.3575 |
2.2045 |
0.0000 |
|
1.6115 |
-1.5462 |
0.0000 |
| H10 |
-1.8933 |
0.4562 |
0.0000 |
|
-0.6997 |
-1.8174 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
O4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
|
1.5072 |
2.5372 |
2.3755 |
1.0959 |
1.1008 |
1.1008 |
2.7927 |
3.5308 |
3.2206 |
| C2 |
1.5072 |
|
1.3458 |
1.3848 |
2.1597 |
2.1525 |
2.1525 |
2.1192 |
2.1346 |
1.9265 |
| C3 |
2.5372 |
1.3458 |
| 2.4125 |
2.6845 |
3.2493 |
3.2493 |
1.0870 |
1.0916 |
2.4521 |
| O4 |
2.3755 |
1.3848 |
2.4125 |
| 3.3272 |
2.6447 |
2.6447 |
3.3920 |
2.7091 |
0.9744 |
| H5 |
1.0959 |
2.1597 |
2.6845 |
3.3272 |
| 1.7879 |
1.7879 |
2.4877 |
3.7730 |
4.0613 |
| H6 |
1.1008 |
2.1525 |
3.2493 |
2.6447 |
1.7879 |
| 1.7714 |
3.5557 |
4.1649 |
3.5362 |
| H7 |
1.1008 |
2.1525 |
3.2493 |
2.6447 |
1.7879 |
1.7714 |
| 3.5557 |
4.1649 |
3.5362 |
| H8 |
2.7927 |
2.1192 |
1.0870 |
3.3920 |
2.4877 |
3.5557 |
3.5557 |
| 1.8601 |
3.5322 |
| H9 |
3.5308 |
2.1346 |
1.0916 |
2.7091 |
3.7730 |
4.1649 |
4.1649 |
1.8601 |
| 2.3271 |
| H10 |
3.2206 |
1.9265 |
2.4521 |
0.9744 |
4.0613 |
3.5362 |
3.5362 |
3.5322 |
2.3271 |
|
Maximum atom distance is 4.1649Å
between atoms H6 and H9.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C3 |
125.478 |
|
C1 |
C2 |
O4 |
110.383 |
|
C3 |
C2 |
O4 |
124.139 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
H5 |
111.139 |
|
C2 |
C1 |
H6 |
110.272 |
|
C2 |
C1 |
H7 |
110.272 |
|
C2 |
C3 |
H8 |
120.804 |
|
C2 |
C3 |
H9 |
121.930 |
|
C2 |
O4 |
H10 |
108.232 |
|
H5 |
C1 |
H6 |
108.956 |
|
H5 |
C1 |
H7 |
108.956 |
|
H6 |
C1 |
H7 |
107.146 |
|
H8 |
C3 |
H9 |
117.266 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.