|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHBr2F (dibromofluoromethane)
1A' CS
1910171554
InChI=1S/CHBr2F/c2-1(3)4/h1H INChIKey=LTUTVFXOEGMHMP-UHFFFAOYSA-N
MP2/6-311G**
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.1024 |
0.7816 |
0.0000 |
|
-0.3363 |
0.7056 |
-0.1024 |
| H2 |
-1.0094 |
1.3794 |
0.0000 |
|
-0.5935 |
1.2451 |
-1.0094 |
| F3 |
0.9767 |
1.5906 |
0.0000 |
|
-0.6844 |
1.4358 |
0.9767 |
| Br4 |
-0.1024 |
-0.2912 |
1.6071 |
|
1.5760 |
0.4287 |
-0.1024 |
| Br5 |
-0.1024 |
-0.2912 |
-1.6071 |
|
-1.3254 |
-0.9544 |
-0.1024 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
F3 |
Br4 |
Br5 |
| C1 |
|
1.0863 |
1.3487 |
1.9323 |
1.9323 |
| H2 |
1.0863 |
| 1.9973 |
2.4893 |
2.4893 |
| F3 |
1.3487 |
1.9973 |
| 2.6998 |
2.6998 |
| Br4 |
1.9323 |
2.4893 |
2.6998 |
| 3.2143 |
| Br5 |
1.9323 |
2.4893 |
2.6998 |
3.2143 |
|
Maximum atom distance is 3.2143Å
between atoms Br4 and Br5.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
F3 |
C1 |
Br4 |
109.453 |
|
F3 |
C1 |
Br5 |
109.453 |
|
Br4 |
C1 |
Br5 |
112.550 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
F3 |
109.755 |
|
H2 |
C1 |
Br4 |
107.789 |
|
H2 |
C1 |
Br5 |
107.789 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.