|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CSNH2 (Ethanethioamide)
1A C1
1910171554
InChI=1S/C2H5NS/c1-2(3)4/h1H3,(H2,3,4) INChIKey=YUKQRDCYNOVPGJ-UHFFFAOYSA-N
mPW1PW91/6-311G**
Point group is C1
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.2824 |
0.0623 |
-0.0142 |
|
0.2850 |
0.0495 |
-0.0140 |
| S2 |
-1.3616 |
-0.1138 |
0.0006 |
|
-1.3654 |
-0.0521 |
-0.0001 |
| C3 |
1.2284 |
-1.1059 |
-0.0006 |
|
1.1771 |
-1.1604 |
-0.0000 |
| N4 |
0.8779 |
1.2629 |
-0.0007 |
|
0.9341 |
1.2219 |
-0.0000 |
| H5 |
0.7474 |
-1.9806 |
-0.4285 |
|
0.6572 |
-2.0124 |
-0.4284 |
| H6 |
2.1503 |
-0.8913 |
-0.5479 |
|
2.1081 |
-0.9876 |
-0.5469 |
| H7 |
1.4926 |
-1.3369 |
1.0353 |
|
1.4300 |
-1.4032 |
1.0359 |
| H8 |
1.8785 |
1.3606 |
-0.0059 |
|
1.9381 |
1.2742 |
-0.0047 |
| H9 |
0.3069 |
2.0906 |
0.0304 |
|
0.4012 |
2.0746 |
0.0308 |
Atom - Atom Distances (Å)
| |
C1 |
S2 |
C3 |
N4 |
H5 |
H6 |
H7 |
H8 |
H9 |
| C1 |
| 1.6535 |
1.5033 |
1.3402 |
2.1358 |
2.1641 |
2.1268 |
2.0574 |
2.0289 |
| S2 |
1.6535 |
| 2.7735 |
2.6288 |
2.8490 |
3.6386 |
3.2730 |
3.5598 |
2.7648 |
| C3 |
1.5033 |
2.7735 |
| 2.3946 |
1.0861 |
1.0935 |
1.0937 |
2.5508 |
3.3268 |
| N4 |
1.3402 |
2.6288 |
2.3946 |
| 3.2742 |
2.5611 |
2.8653 |
1.0054 |
1.0060 |
| H5 |
2.1358 |
2.8490 |
1.0861 |
3.2742 |
| 1.7802 |
1.7642 |
3.5527 |
4.1206 |
| H6 |
2.1641 |
3.6386 |
1.0935 |
2.5611 |
1.7802 |
| 1.7714 |
2.3321 |
3.5531 |
| H7 |
2.1268 |
3.2730 |
1.0937 |
2.8653 |
1.7642 |
1.7714 |
| 2.9171 |
3.7634 |
| H8 |
2.0574 |
3.5598 |
2.5508 |
1.0054 |
3.5527 |
2.3321 |
2.9171 |
| 1.7332 |
| H9 |
2.0289 |
2.7648 |
3.3268 |
1.0060 |
4.1206 |
3.5531 |
3.7634 |
1.7332 |
|
Maximum atom distance is 4.1206Å
between atoms H5 and H9.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
S2 |
C1 |
C3 |
122.873 |
|
S2 |
C1 |
N4 |
122.485 |
|
C3 |
C1 |
N4 |
114.616 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H5 |
110.099 |
|
C1 |
C3 |
H6 |
111.929 |
|
C1 |
C3 |
H7 |
108.945 |
|
C1 |
N4 |
H8 |
121.950 |
|
C1 |
N4 |
H9 |
119.025 |
|
H5 |
C3 |
H6 |
109.527 |
|
H5 |
C3 |
H7 |
108.068 |
|
H6 |
C3 |
H7 |
108.172 |
|
H8 |
N4 |
H9 |
119.018 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.