|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COCH3 (Acetone)
1A1 C2V
1910171554
InChI=1S/C3H6O/c1-3(2)4/h1-2H3 INChIKey=CSCPPACGZOOCGX-UHFFFAOYSA-N
MP2/aug-cc-pVQZ
Point group is C2
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.1820 |
|
0.0000 |
0.1820 |
0.0000 |
| O2 |
0.0000 |
0.0000 |
1.3985 |
|
0.0000 |
1.3985 |
0.0000 |
| C3 |
0.0000 |
1.2798 |
-0.6129 |
|
1.2798 |
-0.6129 |
0.0000 |
| C4 |
0.0000 |
-1.2798 |
-0.6129 |
|
-1.2798 |
-0.6129 |
0.0000 |
| H5 |
0.0008 |
2.1332 |
0.0560 |
|
2.1332 |
0.0560 |
0.0008 |
| H6 |
-0.0008 |
-2.1332 |
0.0560 |
|
-2.1332 |
0.0560 |
-0.0008 |
| H7 |
0.8755 |
1.3138 |
-1.2600 |
|
1.3138 |
-1.2600 |
0.8755 |
| H8 |
-0.8763 |
1.3145 |
-1.2588 |
|
1.3145 |
-1.2588 |
-0.8763 |
| H9 |
-0.8755 |
-1.3138 |
-1.2600 |
|
-1.3138 |
-1.2600 |
-0.8755 |
| H10 |
0.8763 |
-1.3145 |
-1.2588 |
|
-1.3145 |
-1.2588 |
0.8763 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
|
1.2165 |
1.5066 |
1.5066 |
2.1370 |
2.1370 |
2.1382 |
2.1382 |
2.1382 |
2.1382 |
| O2 |
1.2165 |
| 2.3841 |
2.3841 |
2.5205 |
2.5205 |
3.0920 |
3.0915 |
3.0920 |
3.0915 |
| C3 |
1.5066 |
2.3841 |
| 2.5597 |
1.0843 |
3.4780 |
1.0892 |
1.0892 |
2.8129 |
2.8135 |
| C4 |
1.5066 |
2.3841 |
2.5597 |
| 3.4780 |
1.0843 |
2.8129 |
2.8135 |
1.0892 |
1.0892 |
| H5 |
2.1370 |
2.5205 |
1.0843 |
3.4780 |
| 4.2665 |
1.7800 |
1.7800 |
3.7923 |
3.7924 |
| H6 |
2.1370 |
2.5205 |
3.4780 |
1.0843 |
4.2665 |
| 3.7923 |
3.7924 |
1.7800 |
1.7800 |
| H7 |
2.1382 |
3.0920 |
1.0892 |
2.8129 |
1.7800 |
3.7923 |
| 1.7519 |
3.1576 |
2.6283 |
| H8 |
2.1382 |
3.0915 |
1.0892 |
2.8135 |
1.7800 |
3.7924 |
1.7519 |
| 2.6283 |
3.1597 |
| H9 |
2.1382 |
3.0920 |
2.8129 |
1.0892 |
3.7923 |
1.7800 |
3.1576 |
2.6283 |
| 1.7519 |
| H10 |
2.1382 |
3.0915 |
2.8135 |
1.0892 |
3.7924 |
1.7800 |
2.6283 |
3.1597 |
1.7519 |
|
Maximum atom distance is 4.2665Å
between atoms H5 and H6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
C1 |
C3 |
121.844 |
|
O2 |
C1 |
C4 |
121.844 |
|
C3 |
C1 |
C4 |
116.312 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H5 |
110.067 |
|
C1 |
C3 |
H7 |
109.871 |
|
C1 |
C3 |
H8 |
109.873 |
|
C1 |
C4 |
H6 |
110.067 |
|
C1 |
C4 |
H9 |
109.871 |
|
C1 |
C4 |
H10 |
109.873 |
|
H5 |
C3 |
H7 |
109.958 |
|
H5 |
C3 |
H8 |
109.961 |
|
H6 |
C4 |
H9 |
109.958 |
|
H6 |
C4 |
H10 |
109.961 |
|
H7 |
C3 |
H8 |
107.063 |
|
H9 |
C4 |
H10 |
107.063 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.