|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CH2COOH (Propanoic Acid)
1A' CS
1910171554
InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5) INChIKey=XBDQKXXYIPTUBI-UHFFFAOYSA-N
LSDA/6-31G**
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.5598 |
0.0000 |
|
0.5512 |
0.0975 |
0.0000 |
| C2 |
-0.6214 |
-0.7972 |
0.0000 |
|
-0.6768 |
-0.7508 |
0.0000 |
| C3 |
0.4145 |
-1.8899 |
0.0000 |
|
-1.9332 |
0.0788 |
0.0000 |
| O4 |
-0.9230 |
1.5381 |
0.0000 |
|
1.6753 |
-0.6409 |
0.0000 |
| O5 |
1.1917 |
0.7881 |
0.0000 |
|
0.5684 |
1.3108 |
0.0000 |
| H6 |
-1.2941 |
-0.8560 |
0.8759 |
|
-0.6175 |
-1.4234 |
0.8759 |
| H7 |
-1.2941 |
-0.8560 |
-0.8759 |
|
-0.6175 |
-1.4234 |
-0.8759 |
| H8 |
-0.0530 |
-2.8864 |
0.0000 |
|
-2.8330 |
-0.5551 |
0.0000 |
| H9 |
1.0669 |
-1.8088 |
-0.8833 |
|
-1.9670 |
0.7354 |
-0.8833 |
| H10 |
1.0669 |
-1.8088 |
0.8833 |
|
-1.9670 |
0.7354 |
0.8833 |
| H11 |
-0.4008 |
2.3709 |
0.0000 |
|
2.4045 |
0.0184 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
O4 |
O5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
| C1 |
|
1.4925 |
2.4845 |
1.3450 |
1.2134 |
2.1087 |
2.1087 |
3.4466 |
2.7438 |
2.7438 |
1.8550 |
| C2 |
1.4925 |
|
1.5057 |
2.3547 |
2.4085 |
1.1060 |
1.1060 |
2.1651 |
2.1573 |
2.1573 |
3.1758 |
| C3 |
2.4845 |
1.5057 |
| 3.6797 |
2.7885 |
2.1807 |
2.1807 |
1.1007 |
1.1011 |
1.1011 |
4.3382 |
| O4 |
1.3450 |
2.3547 |
3.6797 |
| 2.2438 |
2.5762 |
2.5762 |
4.5092 |
3.9927 |
3.9927 |
0.9830 |
| O5 |
1.2134 |
2.4085 |
2.7885 |
2.2438 |
| 3.1064 |
3.1064 |
3.8796 |
2.7458 |
2.7458 |
2.2453 |
| H6 |
2.1087 |
1.1060 |
2.1807 |
2.5762 |
3.1064 |
| 1.7518 |
2.5357 |
3.0947 |
2.5460 |
3.4610 |
| H7 |
2.1087 |
1.1060 |
2.1807 |
2.5762 |
3.1064 |
1.7518 |
| 2.5357 |
2.5460 |
3.0947 |
3.4610 |
| H8 |
3.4466 |
2.1651 |
1.1007 |
4.5092 |
3.8796 |
2.5357 |
2.5357 |
| 1.7877 |
1.7877 |
5.2688 |
| H9 |
2.7438 |
2.1573 |
1.1011 |
3.9927 |
2.7458 |
3.0947 |
2.5460 |
1.7877 |
| 1.7666 |
4.5171 |
| H10 |
2.7438 |
2.1573 |
1.1011 |
3.9927 |
2.7458 |
2.5460 |
3.0947 |
1.7877 |
1.7666 |
| 4.5171 |
| H11 |
1.8550 |
3.1758 |
4.3382 |
0.9830 |
2.2453 |
3.4610 |
3.4610 |
5.2688 |
4.5171 |
4.5171 |
|
Maximum atom distance is 5.2688Å
between atoms H8 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C3 |
111.925 |
|
C2 |
C1 |
O4 |
112.061 |
|
C2 |
C1 |
O5 |
125.449 |
|
O4 |
C1 |
O5 |
122.490 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H6 |
107.552 |
|
C1 |
C2 |
H7 |
107.552 |
|
C1 |
O4 |
H11 |
104.579 |
|
C2 |
C3 |
H8 |
111.396 |
|
C2 |
C3 |
H9 |
110.743 |
|
C2 |
C3 |
H10 |
110.743 |
|
C3 |
C2 |
H6 |
112.326 |
|
C3 |
C2 |
H7 |
112.326 |
|
H6 |
C2 |
H7 |
104.741 |
|
H8 |
C3 |
H9 |
108.565 |
|
H8 |
C3 |
H10 |
108.565 |
|
H9 |
C3 |
H10 |
106.676 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.