|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C5H4O2 (4-Cyclopentene-1,3-dione)
1A1 C2V
1910171554
InChI=1S/C5H4O2/c6-4-1-2-5(7)3-4/h1-2H,3H2 INChIKey=MCFZBCCYOPSZLG-UHFFFAOYSA-N
PBEPBE/6-31G**
Point group is C2v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
1.0913 |
|
1.0913 |
0.0000 |
0.0000 |
| C2 |
0.0000 |
1.2080 |
0.1490 |
|
0.1490 |
0.0000 |
1.2080 |
| C3 |
0.0000 |
-1.2080 |
0.1490 |
|
0.1490 |
0.0000 |
-1.2080 |
| C4 |
0.0000 |
0.6775 |
-1.2504 |
|
-1.2504 |
0.0000 |
0.6775 |
| C5 |
0.0000 |
-0.6775 |
-1.2504 |
|
-1.2504 |
0.0000 |
-0.6775 |
| O6 |
0.0000 |
2.3914 |
0.4630 |
|
0.4630 |
0.0000 |
2.3914 |
| O7 |
0.0000 |
-2.3914 |
0.4630 |
|
0.4630 |
0.0000 |
-2.3914 |
| H8 |
0.8858 |
0.0000 |
1.7481 |
|
1.7481 |
0.8858 |
0.0000 |
| H9 |
-0.8858 |
0.0000 |
1.7481 |
|
1.7481 |
-0.8858 |
0.0000 |
| H10 |
0.0000 |
1.3426 |
-2.1173 |
|
-2.1173 |
0.0000 |
1.3426 |
| H11 |
0.0000 |
-1.3426 |
-2.1173 |
|
-2.1173 |
0.0000 |
-1.3426 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
C4 |
C5 |
O6 |
O7 |
H8 |
H9 |
H10 |
H11 |
| C1 |
|
1.5321 |
1.5321 |
2.4377 |
2.4377 |
2.4726 |
2.4726 |
1.1028 |
1.1028 |
3.4782 |
3.4782 |
| C2 |
1.5321 |
| 2.4161 |
1.4966 |
2.3480 |
1.2243 |
3.6131 |
2.1912 |
2.1912 |
2.2703 |
3.4121 |
| C3 |
1.5321 |
2.4161 |
| 2.3480 |
1.4966 |
3.6131 |
1.2243 |
2.1912 |
2.1912 |
3.4121 |
2.2703 |
| C4 |
2.4377 |
1.4966 |
2.3480 |
|
1.3549 |
2.4234 |
3.5148 |
3.1992 |
3.1992 |
1.0927 |
2.1983 |
| C5 |
2.4377 |
2.3480 |
1.4966 |
1.3549 |
| 3.5148 |
2.4234 |
3.1992 |
3.1992 |
2.1983 |
1.0927 |
| O6 |
2.4726 |
1.2243 |
3.6131 |
2.4234 |
3.5148 |
| 4.7828 |
2.8557 |
2.8557 |
2.7853 |
4.5388 |
| O7 |
2.4726 |
3.6131 |
1.2243 |
3.5148 |
2.4234 |
4.7828 |
| 2.8557 |
2.8557 |
4.5388 |
2.7853 |
| H8 |
1.1028 |
2.1912 |
2.1912 |
3.1992 |
3.1992 |
2.8557 |
2.8557 |
| 1.7717 |
4.1868 |
4.1868 |
| H9 |
1.1028 |
2.1912 |
2.1912 |
3.1992 |
3.1992 |
2.8557 |
2.8557 |
1.7717 |
| 4.1868 |
4.1868 |
| H10 |
3.4782 |
2.2703 |
3.4121 |
1.0927 |
2.1983 |
2.7853 |
4.5388 |
4.1868 |
4.1868 |
| 2.6853 |
| H11 |
3.4782 |
3.4121 |
2.2703 |
2.1983 |
1.0927 |
4.5388 |
2.7853 |
4.1868 |
4.1868 |
2.6853 |
|
Maximum atom distance is 4.7828Å
between atoms O6 and O7.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C4 |
107.190 |
|
C1 |
C2 |
O6 |
127.185 |
|
C1 |
C3 |
C5 |
107.190 |
|
C1 |
C3 |
O7 |
127.185 |
|
C2 |
C1 |
C3 |
104.091 |
|
C2 |
C4 |
C5 |
110.764 |
|
C3 |
C5 |
C4 |
110.764 |
|
C4 |
C2 |
O6 |
125.625 |
|
C5 |
C3 |
O7 |
125.625 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
H8 |
111.490 |
|
C2 |
C1 |
H9 |
111.490 |
|
C2 |
C4 |
H10 |
121.739 |
|
C3 |
C1 |
H8 |
111.490 |
|
C3 |
C1 |
H9 |
111.490 |
|
C3 |
C5 |
H11 |
121.739 |
|
C4 |
C5 |
H11 |
127.496 |
|
C5 |
C4 |
H10 |
127.496 |
|
H8 |
C1 |
H9 |
106.882 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.