|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C6H6 (Dewar Benzene)
1A1 C2V
1910171554
InChI=1S/C6H6/c1-2-6-4-3-5(1)6/h1-6H INChIKey=CTLSARLLLBZBRV-UHFFFAOYSA-N
B3LYPultrafine/6-31G**
Point group is C2v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.7868 |
0.5209 |
|
0.0000 |
0.7868 |
0.5209 |
| C2 |
0.0000 |
-0.7868 |
0.5209 |
|
0.0000 |
-0.7868 |
0.5209 |
| H3 |
0.0000 |
1.3517 |
1.4569 |
|
0.0000 |
1.3517 |
1.4569 |
| H4 |
0.0000 |
-1.3517 |
1.4569 |
|
0.0000 |
-1.3517 |
1.4569 |
| C5 |
-1.3083 |
0.6699 |
-0.2641 |
|
-1.3083 |
0.6699 |
-0.2641 |
| C6 |
1.3083 |
0.6699 |
-0.2641 |
|
1.3083 |
0.6699 |
-0.2641 |
| C7 |
1.3083 |
-0.6699 |
-0.2641 |
|
1.3083 |
-0.6699 |
-0.2641 |
| C8 |
-1.3083 |
-0.6699 |
-0.2641 |
|
-1.3083 |
-0.6699 |
-0.2641 |
| H9 |
-1.9559 |
1.4203 |
-0.7070 |
|
-1.9559 |
1.4203 |
-0.7070 |
| H10 |
1.9559 |
1.4203 |
-0.7070 |
|
1.9559 |
1.4203 |
-0.7070 |
| H11 |
1.9559 |
-1.4203 |
-0.7070 |
|
1.9559 |
-1.4203 |
-0.7070 |
| H12 |
-1.9559 |
-1.4203 |
-0.7070 |
|
-1.9559 |
-1.4203 |
-0.7070 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
H3 |
H4 |
C5 |
C6 |
C7 |
C8 |
H9 |
H10 |
H11 |
H12 |
| C1 |
|
1.5736 |
1.0932 |
2.3343 |
1.5302 |
1.5302 |
2.1095 |
2.1095 |
2.3947 |
2.3947 |
3.1945 |
3.1945 |
| C2 |
1.5736 |
| 2.3343 |
1.0932 |
2.1095 |
2.1095 |
1.5302 |
1.5302 |
3.1945 |
3.1945 |
2.3947 |
2.3947 |
| H3 |
1.0932 |
2.3343 |
| 2.7033 |
2.2668 |
2.2668 |
2.9598 |
2.9598 |
2.9177 |
2.9177 |
4.0239 |
4.0239 |
| H4 |
2.3343 |
1.0932 |
2.7033 |
| 2.9598 |
2.9598 |
2.2668 |
2.2668 |
4.0239 |
4.0239 |
2.9177 |
2.9177 |
| C5 |
1.5302 |
2.1095 |
2.2668 |
2.9598 |
| 2.6167 |
2.9397 |
1.3398 |
1.0857 |
3.3786 |
3.9013 |
2.2326 |
| C6 |
1.5302 |
2.1095 |
2.2668 |
2.9598 |
2.6167 |
|
1.3398 |
2.9397 |
3.3786 |
1.0857 |
2.2326 |
3.9013 |
| C7 |
2.1095 |
1.5302 |
2.9598 |
2.2668 |
2.9397 |
1.3398 |
| 2.6167 |
3.9013 |
2.2326 |
1.0857 |
3.3786 |
| C8 |
2.1095 |
1.5302 |
2.9598 |
2.2668 |
1.3398 |
2.9397 |
2.6167 |
| 2.2326 |
3.9013 |
3.3786 |
1.0857 |
| H9 |
2.3947 |
3.1945 |
2.9177 |
4.0239 |
1.0857 |
3.3786 |
3.9013 |
2.2326 |
| 3.9119 |
4.8344 |
2.8406 |
| H10 |
2.3947 |
3.1945 |
2.9177 |
4.0239 |
3.3786 |
1.0857 |
2.2326 |
3.9013 |
3.9119 |
| 2.8406 |
4.8344 |
| H11 |
3.1945 |
2.3947 |
4.0239 |
2.9177 |
3.9013 |
2.2326 |
1.0857 |
3.3786 |
4.8344 |
2.8406 |
| 3.9119 |
| H12 |
3.1945 |
2.3947 |
4.0239 |
2.9177 |
2.2326 |
3.9013 |
3.3786 |
1.0857 |
2.8406 |
4.8344 |
3.9119 |
|
Maximum atom distance is 4.8344Å
between atoms H9 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C4 |
121.111 |
|
C2 |
C1 |
C3 |
121.111 |
|
C2 |
C1 |
C5 |
85.618 |
|
C2 |
C1 |
C6 |
85.618 |
|
C3 |
C1 |
C5 |
118.600 |
|
C3 |
C1 |
C6 |
118.600 |
|
C5 |
C1 |
C6 |
117.517 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H7 |
85.618 |
|
C1 |
C2 |
H8 |
85.618 |
|
C1 |
C5 |
H8 |
94.382 |
|
C1 |
C5 |
H9 |
131.796 |
|
C1 |
C6 |
H7 |
94.382 |
|
C1 |
C6 |
H10 |
131.796 |
|
C2 |
H7 |
C6 |
94.382 |
|
C2 |
H7 |
H11 |
131.796 |
|
C2 |
H8 |
C5 |
94.382 |
|
C2 |
H8 |
H12 |
131.796 |
|
C4 |
C2 |
H7 |
118.600 |
|
C4 |
C2 |
H8 |
118.600 |
|
C5 |
H8 |
H12 |
133.725 |
|
C6 |
H7 |
H11 |
133.725 |
|
H7 |
C6 |
H10 |
133.725 |
|
H8 |
C5 |
H9 |
133.725 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.