|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C2ClF3 (Ethene, chlorotrifluoro-)
1A' CS
1910171554
InChI=1S/C2ClF3/c3-1(4)2(5)6 INChIKey=UUAGAQFQZIEFAH-UHFFFAOYSA-N
B3PW91/6-31G**
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.6868 |
-0.6661 |
0.0000 |
|
-0.9376 |
-0.1903 |
0.0000 |
| C2 |
0.0000 |
0.4730 |
0.0000 |
|
0.2552 |
0.3983 |
0.0000 |
| F3 |
-2.0030 |
-0.7108 |
0.0000 |
|
-2.0699 |
0.4822 |
0.0000 |
| F4 |
-0.1307 |
-1.8582 |
0.0000 |
|
-1.1126 |
-1.4940 |
0.0000 |
| F5 |
-0.6361 |
1.6423 |
0.0000 |
|
0.3505 |
1.7259 |
0.0000 |
| Cl6 |
1.7087 |
0.5588 |
0.0000 |
|
1.7401 |
-0.4515 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
F3 |
F4 |
F5 |
Cl6 |
| C1 |
|
1.3301 |
1.3170 |
1.3155 |
2.3089 |
2.6904 |
| C2 |
1.3301 |
| 2.3267 |
2.3349 |
1.3311 |
1.7109 |
| F3 |
1.3170 |
2.3267 |
| 2.1959 |
2.7213 |
3.9228 |
| F4 |
1.3155 |
2.3349 |
2.1959 |
| 3.5368 |
3.0373 |
| F5 |
2.3089 |
1.3311 |
2.7213 |
3.5368 |
| 2.5830 |
| Cl6 |
2.6904 |
1.7109 |
3.9228 |
3.0373 |
2.5830 |
|
Maximum atom distance is 3.9228Å
between atoms F3 and Cl6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
F5 |
120.367 |
|
C1 |
C2 |
Cl6 |
123.959 |
|
C2 |
C1 |
F3 |
123.034 |
|
C2 |
C1 |
F4 |
123.906 |
|
F3 |
C1 |
F4 |
113.060 |
|
F5 |
C2 |
Cl6 |
115.674 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.