|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHCl2CHF2 (1,1-dichloro-2,2-difluoroethane)
1A' CS
1910171554
InChI=1S/C2H2Cl2F2/c3-1(4)2(5)6/h1-2H INChIKey=VLIDBBNDBSNADN-UHFFFAOYSA-N
CCD/6-31G**
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.3995 |
-0.2282 |
0.0000 |
|
0.0124 |
0.3993 |
-0.2282 |
| C2 |
-0.3606 |
1.0937 |
0.0000 |
|
-0.0112 |
-0.3604 |
1.0937 |
| H3 |
1.4726 |
-0.0544 |
0.0000 |
|
0.0456 |
1.4719 |
-0.0544 |
| H4 |
-1.4337 |
0.9199 |
0.0000 |
|
-0.0444 |
-1.4330 |
0.9199 |
| Cl5 |
-0.0052 |
-1.1365 |
1.4657 |
|
1.4648 |
-0.0507 |
-1.1365 |
| Cl6 |
-0.0052 |
-1.1365 |
-1.4657 |
|
-1.4652 |
0.0402 |
-1.1365 |
| F7 |
-0.0052 |
1.8102 |
1.0961 |
|
1.0954 |
-0.0392 |
1.8102 |
| F8 |
-0.0052 |
1.8102 |
-1.0961 |
|
-1.0958 |
0.0287 |
1.8102 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
H3 |
H4 |
Cl5 |
Cl6 |
F7 |
F8 |
| C1 |
|
1.5249 |
1.0871 |
2.1631 |
1.7712 |
1.7712 |
2.3496 |
2.3496 |
| C2 |
1.5249 |
| 2.1631 |
1.0871 |
2.6923 |
2.6923 |
1.3569 |
1.3569 |
| H3 |
1.0871 |
2.1631 |
| 3.0652 |
2.3459 |
2.3459 |
2.6196 |
2.6196 |
| H4 |
2.1631 |
1.0871 |
3.0652 |
| 2.9013 |
2.9013 |
2.0086 |
2.0086 |
| Cl5 |
1.7712 |
2.6923 |
2.3459 |
2.9013 |
| 2.9314 |
2.9698 |
3.9046 |
| Cl6 |
1.7712 |
2.6923 |
2.3459 |
2.9013 |
2.9314 |
| 3.9046 |
2.9698 |
| F7 |
2.3496 |
1.3569 |
2.6196 |
2.0086 |
2.9698 |
3.9046 |
| 2.1923 |
| F8 |
2.3496 |
1.3569 |
2.6196 |
2.0086 |
3.9046 |
2.9698 |
2.1923 |
|
Maximum atom distance is 3.9046Å
between atoms Cl5 and F8.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
F7 |
109.100 |
|
C1 |
C2 |
F8 |
109.100 |
|
C2 |
C1 |
Cl5 |
109.309 |
|
C2 |
C1 |
Cl6 |
109.309 |
|
Cl5 |
C1 |
Cl6 |
111.691 |
|
F7 |
C2 |
F8 |
107.769 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H4 |
110.698 |
|
C2 |
C1 |
H3 |
110.697 |
|
H3 |
C1 |
Cl5 |
107.913 |
|
H3 |
C1 |
Cl6 |
107.913 |
|
H4 |
C2 |
F7 |
110.057 |
|
H4 |
C2 |
F8 |
110.057 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.