|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C4H6O2 (2-Propenoic acid, methyl ester)
1A C1
1910171554
InChI=1S/C4H6O2/c1-3-4(5)6-2/h3H,1H2,2H3 INChIKey=BAPJBEWLBFYGME-UHFFFAOYSA-N
HF/6-31G**
Point group is C1
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| H1 |
-2.9996 |
-0.9065 |
-0.0022 |
|
-3.0054 |
-0.8868 |
-0.0023 |
| H2 |
-2.4194 |
0.5212 |
-0.8798 |
|
-2.4159 |
0.5372 |
-0.8798 |
| H3 |
-2.4212 |
0.5179 |
0.8819 |
|
-2.4178 |
0.5337 |
0.8819 |
| C4 |
-2.2896 |
-0.0936 |
0.0000 |
|
-2.2901 |
-0.0785 |
-0.0000 |
| O5 |
-1.0079 |
-0.6967 |
0.0005 |
|
-1.0125 |
-0.6900 |
0.0004 |
| O6 |
-0.0545 |
1.3039 |
-0.0004 |
|
-0.0460 |
1.3042 |
-0.0002 |
| C7 |
0.0371 |
0.1168 |
-0.0000 |
|
0.0378 |
0.1165 |
-0.0000 |
| H8 |
1.2400 |
-1.7152 |
-0.0016 |
|
1.2287 |
-1.7233 |
-0.0018 |
| C9 |
1.3133 |
-0.6434 |
-0.0006 |
|
1.3091 |
-0.6520 |
-0.0006 |
| H10 |
3.4022 |
-0.5478 |
0.0003 |
|
3.3986 |
-0.5701 |
0.0002 |
| H11 |
2.5090 |
1.0627 |
0.0016 |
|
2.5159 |
1.0462 |
0.0017 |
| C12 |
2.4706 |
-0.0114 |
0.0004 |
|
2.4705 |
-0.0276 |
0.0004 |
Atom - Atom Distances (Å)
| |
H1 |
H2 |
H3 |
C4 |
O5 |
O6 |
C7 |
H8 |
C9 |
H10 |
H11 |
C12 |
| H1 |
| 1.7734 |
1.7733 |
1.0793 |
2.0026 |
3.6822 |
3.2044 |
4.3160 |
4.3209 |
6.4118 |
5.8499 |
5.5429 |
| H2 |
1.7734 |
| 1.7617 |
1.0811 |
2.0616 |
2.6417 |
2.6404 |
4.3776 |
4.0078 |
5.9840 |
5.0357 |
4.9971 |
| H3 |
1.7733 |
1.7617 |
|
1.0811 |
2.0614 |
2.6452 |
2.6423 |
4.3785 |
4.0093 |
5.9854 |
5.0377 |
4.9987 |
| C4 |
1.0793 |
1.0811 |
1.0811 |
|
1.4164 |
2.6359 |
2.3361 |
3.8843 |
3.6446 |
5.7099 |
4.9359 |
4.7609 |
| O5 |
2.0026 |
2.0616 |
2.0614 |
1.4164 |
| 2.2161 |
1.3243 |
2.4679 |
2.3219 |
4.4127 |
3.9324 |
3.5454 |
| O6 |
3.6822 |
2.6417 |
2.6452 |
2.6359 |
2.2161 |
|
1.1906 |
3.2849 |
2.3797 |
3.9214 |
2.5748 |
2.8472 |
| C7 |
3.2044 |
2.6404 |
2.6423 |
2.3361 |
1.3243 |
1.1906 |
| 2.1916 |
1.4855 |
3.4302 |
2.6467 |
2.4369 |
| H8 |
4.3160 |
4.3776 |
4.3785 |
3.8843 |
2.4679 |
3.2849 |
2.1916 |
|
1.0742 |
2.4572 |
3.0540 |
2.1017 |
| C9 |
4.3209 |
4.0078 |
4.0093 |
3.6446 |
2.3219 |
2.3797 |
1.4855 |
1.0742 |
| 2.0911 |
2.0834 |
1.3186 |
| H10 |
6.4118 |
5.9840 |
5.9854 |
5.7099 |
4.4127 |
3.9214 |
3.4302 |
2.4572 |
2.0911 |
| 1.8416 |
1.0750 |
| H11 |
5.8499 |
5.0357 |
5.0377 |
4.9359 |
3.9324 |
2.5748 |
2.6467 |
3.0540 |
2.0834 |
1.8416 |
|
1.0748 |
| C12 |
5.5429 |
4.9971 |
4.9987 |
4.7609 |
3.5454 |
2.8472 |
2.4369 |
2.1017 |
1.3186 |
1.0750 |
1.0748 |
|
Maximum atom distance is 6.4118Å
between atoms H1 and H10.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C4 |
O5 |
C7 |
116.903 |
|
O5 |
C7 |
O6 |
123.485 |
|
O5 |
C7 |
C9 |
111.324 |
|
O6 |
C7 |
C9 |
125.191 |
|
C7 |
C9 |
C12 |
120.580 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H1 |
C4 |
H2 |
110.343 |
|
H1 |
C4 |
H3 |
110.335 |
|
H1 |
C4 |
O5 |
105.933 |
|
H2 |
C4 |
H3 |
109.122 |
|
H2 |
C4 |
O5 |
110.551 |
|
H3 |
C4 |
O5 |
110.529 |
|
C7 |
C9 |
H8 |
116.865 |
|
H8 |
C9 |
C12 |
122.555 |
|
C9 |
C12 |
H10 |
121.428 |
|
C9 |
C12 |
H11 |
120.685 |
|
H10 |
C12 |
H11 |
117.886 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.