|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COCH3 (Acetone)
1A1 C2V
1910171554
InChI=1S/C3H6O/c1-3(2)4/h1-2H3 INChIKey=CSCPPACGZOOCGX-UHFFFAOYSA-N
PBEPBE/6-31G**
Point group is C2
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.1853 |
|
0.1853 |
0.0000 |
0.0000 |
| O2 |
0.0000 |
0.0000 |
1.4108 |
|
1.4108 |
0.0000 |
0.0000 |
| C3 |
0.0000 |
1.2935 |
-0.6180 |
|
-0.6180 |
-0.0000 |
1.2935 |
| C4 |
0.0000 |
-1.2935 |
-0.6180 |
|
-0.6180 |
-0.0000 |
-1.2935 |
| H5 |
0.0009 |
2.1555 |
0.0624 |
|
0.0624 |
0.0009 |
2.1555 |
| H6 |
-0.0009 |
-2.1555 |
0.0624 |
|
0.0624 |
-0.0009 |
-2.1555 |
| H7 |
0.8839 |
1.3399 |
-1.2776 |
|
-1.2776 |
0.8839 |
1.3399 |
| H8 |
-0.8852 |
1.3407 |
-1.2759 |
|
-1.2758 |
-0.8853 |
1.3407 |
| H9 |
-0.8839 |
-1.3399 |
-1.2776 |
|
-1.2776 |
-0.8839 |
-1.3399 |
| H10 |
0.8852 |
-1.3407 |
-1.2759 |
|
-1.2759 |
0.8852 |
-1.3407 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
|
1.2255 |
1.5227 |
1.5227 |
2.1590 |
2.1590 |
2.1719 |
2.1716 |
2.1719 |
2.1716 |
| O2 |
1.2255 |
| 2.4061 |
2.4061 |
2.5425 |
2.5425 |
3.1312 |
3.1304 |
3.1312 |
3.1304 |
| C3 |
1.5227 |
2.4061 |
| 2.5871 |
1.0981 |
3.5155 |
1.1039 |
1.1039 |
2.8551 |
2.8558 |
| C4 |
1.5227 |
2.4061 |
2.5871 |
| 3.5155 |
1.0981 |
2.8551 |
2.8558 |
1.1039 |
1.1039 |
| H5 |
2.1590 |
2.5425 |
1.0981 |
3.5155 |
| 4.3109 |
1.8001 |
1.8000 |
3.8466 |
3.8465 |
| H6 |
2.1590 |
2.5425 |
3.5155 |
1.0981 |
4.3109 |
| 3.8466 |
3.8465 |
1.8001 |
1.8000 |
| H7 |
2.1719 |
3.1312 |
1.1039 |
2.8551 |
1.8001 |
3.8466 |
| 1.7692 |
3.2105 |
2.6806 |
| H8 |
2.1716 |
3.1304 |
1.1039 |
2.8558 |
1.8000 |
3.8465 |
1.7692 |
| 2.6806 |
3.2131 |
| H9 |
2.1719 |
3.1312 |
2.8551 |
1.1039 |
3.8466 |
1.8001 |
3.2105 |
2.6806 |
| 1.7692 |
| H10 |
2.1716 |
3.1304 |
2.8558 |
1.1039 |
3.8465 |
1.8000 |
2.6806 |
3.2131 |
1.7692 |
|
Maximum atom distance is 4.3109Å
between atoms H5 and H6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
C1 |
C3 |
121.841 |
|
O2 |
C1 |
C4 |
121.841 |
|
C3 |
C1 |
C4 |
116.318 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H5 |
109.872 |
|
C1 |
C3 |
H7 |
110.545 |
|
C1 |
C3 |
H8 |
110.526 |
|
C1 |
C4 |
H6 |
109.872 |
|
C1 |
C4 |
H9 |
110.545 |
|
C1 |
C4 |
H10 |
110.526 |
|
H5 |
C3 |
H7 |
109.670 |
|
H5 |
C3 |
H8 |
109.656 |
|
H6 |
C4 |
H9 |
109.670 |
|
H6 |
C4 |
H10 |
109.656 |
|
H7 |
C3 |
H8 |
106.514 |
|
H9 |
C4 |
H10 |
106.514 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.