|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CH(CH3)CN (Propanenitrile, 2-methyl-)
1A' CS
1910171554
InChI=1S/C4H7N/c1-4(2)3-5/h4H,1-2H3 INChIKey=LRDFRRGEGBBSRN-UHFFFAOYSA-N
mPW1PW91/6-31G**
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| N1 |
0.4007 |
-2.1786 |
0.0000 |
|
0.0018 |
0.4007 |
-2.1786 |
| C2 |
0.0270 |
-1.0818 |
0.0000 |
|
0.0001 |
0.0270 |
-1.0818 |
| C3 |
-0.4361 |
0.3100 |
0.0000 |
|
-0.0019 |
-0.4361 |
0.3100 |
| C4 |
0.0270 |
1.0277 |
1.2731 |
|
1.2732 |
0.0214 |
1.0277 |
| C5 |
0.0270 |
1.0277 |
-1.2731 |
|
-1.2730 |
0.0327 |
1.0277 |
| H6 |
-1.5320 |
0.2685 |
0.0000 |
|
-0.0068 |
-1.5320 |
0.2685 |
| H7 |
-0.3663 |
2.0468 |
1.2836 |
|
1.2820 |
-0.3720 |
2.0468 |
| H8 |
-0.3227 |
0.5132 |
2.1698 |
|
2.1683 |
-0.3323 |
0.5132 |
| H9 |
1.1173 |
1.0802 |
1.3114 |
|
1.3164 |
1.1115 |
1.0802 |
| H10 |
-0.3663 |
2.0468 |
-1.2836 |
|
-1.2852 |
-0.3607 |
2.0468 |
| H11 |
-0.3227 |
0.5132 |
-2.1698 |
|
-2.1712 |
-0.3131 |
0.5132 |
| H12 |
1.1173 |
1.0802 |
-1.3114 |
|
-1.3065 |
1.1231 |
1.0802 |
Atom - Atom Distances (Å)
| |
N1 |
C2 |
C3 |
C4 |
C5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
H12 |
| N1 |
|
1.1588 |
2.6256 |
3.4700 |
3.4700 |
3.1183 |
4.4822 |
3.5323 |
3.5851 |
4.4822 |
3.5323 |
3.5851 |
| C2 |
1.1588 |
|
1.4668 |
2.4638 |
2.4638 |
2.0624 |
3.4044 |
2.7155 |
2.7537 |
3.4044 |
2.7155 |
2.7537 |
| C3 |
2.6256 |
1.4668 |
|
1.5331 |
1.5331 |
1.0967 |
2.1608 |
2.1822 |
2.1740 |
2.1608 |
2.1822 |
2.1740 |
| C4 |
3.4700 |
2.4638 |
1.5331 |
| 2.5462 |
2.1512 |
1.0925 |
1.0913 |
1.0922 |
2.7804 |
3.4986 |
2.8056 |
| C5 |
3.4700 |
2.4638 |
1.5331 |
2.5462 |
| 2.1512 |
2.7804 |
3.4986 |
2.8056 |
1.0925 |
1.0913 |
1.0922 |
| H6 |
3.1183 |
2.0624 |
1.0967 |
2.1512 |
2.1512 |
| 2.4837 |
2.4960 |
3.0655 |
2.4837 |
2.4960 |
3.0655 |
| H7 |
4.4822 |
3.4044 |
2.1608 |
1.0925 |
2.7804 |
2.4837 |
| 1.7717 |
1.7710 |
2.5673 |
3.7788 |
3.1417 |
| H8 |
3.5323 |
2.7155 |
2.1822 |
1.0913 |
3.4986 |
2.4960 |
1.7717 |
| 1.7697 |
3.7788 |
4.3395 |
3.8097 |
| H9 |
3.5851 |
2.7537 |
2.1740 |
1.0922 |
2.8056 |
3.0655 |
1.7710 |
1.7697 |
| 3.1417 |
3.8097 |
2.6229 |
| H10 |
4.4822 |
3.4044 |
2.1608 |
2.7804 |
1.0925 |
2.4837 |
2.5673 |
3.7788 |
3.1417 |
| 1.7717 |
1.7710 |
| H11 |
3.5323 |
2.7155 |
2.1822 |
3.4986 |
1.0913 |
2.4960 |
3.7788 |
4.3395 |
3.8097 |
1.7717 |
| 1.7697 |
| H12 |
3.5851 |
2.7537 |
2.1740 |
2.8056 |
1.0922 |
3.0655 |
3.1417 |
3.8097 |
2.6229 |
1.7710 |
1.7697 |
|
Maximum atom distance is 4.4822Å
between atoms N1 and H7.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
N1 |
C2 |
C3 |
179.591 |
|
C2 |
C3 |
C4 |
110.413 |
|
C2 |
C3 |
C5 |
110.413 |
|
C4 |
C3 |
C5 |
112.288 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C3 |
H6 |
106.234 |
|
C3 |
C4 |
H7 |
109.627 |
|
C3 |
C4 |
H8 |
111.398 |
|
C3 |
C4 |
H9 |
110.682 |
|
C3 |
C5 |
H10 |
109.627 |
|
C3 |
C5 |
H11 |
111.398 |
|
C3 |
C5 |
H12 |
110.682 |
|
C4 |
C3 |
H6 |
108.638 |
|
C5 |
C3 |
H6 |
108.638 |
|
H7 |
C4 |
H8 |
108.447 |
|
H7 |
C4 |
H9 |
108.315 |
|
H8 |
C4 |
H9 |
108.287 |
|
H10 |
C5 |
H11 |
108.447 |
|
H10 |
C5 |
H12 |
108.315 |
|
H11 |
C5 |
H12 |
108.287 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.