|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3NO3 (Methyl nitrate)
1A' CS
1910171554
InChI=1S/CH3NO3/c1-5-2(3)4/h1H3 INChIKey=LRMHVVPPGGOAJQ-UHFFFAOYSA-N
BLYP/6-31G**
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| N1 |
0.0000 |
0.6474 |
0.0000 |
|
0.6449 |
0.0572 |
0.0000 |
| O2 |
-1.2282 |
0.5937 |
0.0000 |
|
0.6999 |
-1.1710 |
0.0000 |
| O3 |
0.7595 |
1.6027 |
0.0000 |
|
1.5293 |
0.8982 |
0.0000 |
| O4 |
0.7325 |
-0.6470 |
0.0000 |
|
-0.7092 |
0.6724 |
0.0000 |
| C5 |
-0.1696 |
-1.7823 |
0.0000 |
|
-1.7603 |
-0.3265 |
0.0000 |
| H6 |
0.5122 |
-2.6439 |
0.0000 |
|
-2.6788 |
0.2765 |
0.0000 |
| H7 |
-0.8022 |
-1.7946 |
0.9000 |
|
-1.7166 |
-0.9577 |
0.9000 |
| H8 |
-0.8022 |
-1.7946 |
-0.9000 |
|
-1.7166 |
-0.9577 |
-0.9000 |
Atom - Atom Distances (Å)
| |
N1 |
O2 |
O3 |
O4 |
C5 |
H6 |
H7 |
H8 |
| N1 |
|
1.2294 |
1.2204 |
1.4873 |
2.4357 |
3.3310 |
2.7234 |
2.7234 |
| O2 |
1.2294 |
| 2.2292 |
2.3202 |
2.6011 |
3.6758 |
2.5875 |
2.5875 |
| O3 |
1.2204 |
2.2292 |
| 2.2498 |
3.5102 |
4.2538 |
3.8458 |
3.8458 |
| O4 |
1.4873 |
2.3202 |
2.2498 |
|
1.4501 |
2.0091 |
2.1171 |
2.1171 |
| C5 |
2.4357 |
2.6011 |
3.5102 |
1.4501 |
|
1.0988 |
1.1002 |
1.1002 |
| H6 |
3.3310 |
3.6758 |
4.2538 |
2.0091 |
1.0988 |
| 1.8053 |
1.8053 |
| H7 |
2.7234 |
2.5875 |
3.8458 |
2.1171 |
1.1002 |
1.8053 |
| 1.8001 |
| H8 |
2.7234 |
2.5875 |
3.8458 |
2.1171 |
1.1002 |
1.8053 |
1.8001 |
|
Maximum atom distance is 4.2538Å
between atoms O3 and H6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
N1 |
O4 |
C5 |
112.027 |
|
O2 |
N1 |
O3 |
130.996 |
|
O2 |
N1 |
O4 |
116.998 |
|
O3 |
N1 |
O4 |
112.006 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O4 |
C5 |
H6 |
103.175 |
|
O4 |
C5 |
H7 |
111.494 |
|
O4 |
C5 |
H8 |
111.494 |
|
H6 |
C5 |
H7 |
110.369 |
|
H6 |
C5 |
H8 |
110.369 |
|
H7 |
C5 |
H8 |
109.790 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.