|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3SOCH3 (Dimethyl sulfoxide)
1A' CS
1910171554
InChI=1S/C2H6OS/c1-4(2)3/h1-2H3 INChIKey=IAZDPXIOMUYVGZ-UHFFFAOYSA-N
B3LYP/6-31G**
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| S1 |
0.2577 |
0.4300 |
0.0000 |
|
0.2302 |
0.0000 |
0.4453 |
| O2 |
-1.0929 |
1.1087 |
0.0000 |
|
1.5177 |
0.0000 |
-0.3464 |
| C3 |
0.2577 |
-0.8006 |
1.3636 |
|
-0.8164 |
1.3636 |
-0.2020 |
| C4 |
0.2577 |
-0.8006 |
-1.3636 |
|
-0.8164 |
-1.3636 |
-0.2020 |
| H5 |
1.1768 |
-1.3917 |
1.3311 |
|
-1.8026 |
1.3311 |
0.2689 |
| H6 |
1.1768 |
-1.3917 |
-1.3311 |
|
-1.8026 |
-1.3311 |
0.2689 |
| H7 |
0.2114 |
-0.2387 |
2.2982 |
|
-0.3142 |
2.2982 |
0.0542 |
| H8 |
0.2114 |
-0.2387 |
-2.2982 |
|
-0.3142 |
-2.2982 |
0.0542 |
| H9 |
-0.6239 |
-1.4409 |
1.2767 |
|
-0.8973 |
1.2767 |
-1.2884 |
| H10 |
-0.6239 |
-1.4409 |
-1.2767 |
|
-0.8973 |
-1.2767 |
-1.2884 |
Atom - Atom Distances (Å)
| |
S1 |
O2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| S1 |
| 1.5115 |
1.8368 |
1.8368 |
2.4363 |
2.4363 |
2.3940 |
2.3940 |
2.4305 |
2.4305 |
| O2 |
1.5115 |
| 2.7072 |
2.7072 |
3.6298 |
3.6298 |
2.9662 |
2.9662 |
2.8896 |
2.8896 |
| C3 |
1.8368 |
2.7072 |
| 2.7272 |
1.0933 |
2.9079 |
1.0915 |
3.7050 |
1.0930 |
2.8562 |
| C4 |
1.8368 |
2.7072 |
2.7272 |
| 2.9079 |
1.0933 |
3.7050 |
1.0915 |
2.8562 |
1.0930 |
| H5 |
2.4363 |
3.6298 |
1.0933 |
2.9079 |
| 2.6623 |
1.7880 |
3.9286 |
1.8022 |
3.1695 |
| H6 |
2.4363 |
3.6298 |
2.9079 |
1.0933 |
2.6623 |
| 3.9286 |
1.7880 |
3.1695 |
1.8022 |
| H7 |
2.3940 |
2.9662 |
1.0915 |
3.7050 |
1.7880 |
3.9286 |
| 4.5965 |
1.7850 |
3.8630 |
| H8 |
2.3940 |
2.9662 |
3.7050 |
1.0915 |
3.9286 |
1.7880 |
4.5965 |
| 3.8630 |
1.7850 |
| H9 |
2.4305 |
2.8896 |
1.0930 |
2.8562 |
1.8022 |
3.1695 |
1.7850 |
3.8630 |
| 2.5533 |
| H10 |
2.4305 |
2.8896 |
2.8562 |
1.0930 |
3.1695 |
1.8022 |
3.8630 |
1.7850 |
2.5533 |
|
Maximum atom distance is 4.5965Å
between atoms H7 and H8.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
S1 |
C3 |
107.506 |
|
O2 |
S1 |
C4 |
107.506 |
|
C3 |
S1 |
C4 |
95.870 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
S1 |
C3 |
H5 |
109.888 |
|
S1 |
C3 |
H7 |
106.905 |
|
S1 |
C3 |
H9 |
109.476 |
|
S1 |
C4 |
H6 |
109.888 |
|
S1 |
C4 |
H8 |
106.905 |
|
S1 |
C4 |
H10 |
109.476 |
|
H5 |
C3 |
H7 |
109.843 |
|
H5 |
C3 |
H9 |
111.037 |
|
H6 |
C4 |
H8 |
109.843 |
|
H6 |
C4 |
H10 |
111.037 |
|
H7 |
C3 |
H9 |
109.601 |
|
H8 |
C4 |
H10 |
109.601 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.