|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CHBrCH3 (i-propyl bromide)
1A' CS
1910171554
InChI=1S/C3H7Br/c1-3(2)4/h3H,1-2H3 INChIKey=NAMYKGVDVNBCFQ-UHFFFAOYSA-N
HF/6-31G**
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.4510 |
-0.9062 |
0.0000 |
|
0.0210 |
0.4505 |
-0.9062 |
| Br2 |
-0.0656 |
1.0094 |
0.0000 |
|
-0.0031 |
-0.0655 |
1.0094 |
| H3 |
1.5297 |
-0.8682 |
0.0000 |
|
0.0712 |
1.5280 |
-0.8682 |
| C4 |
-0.0656 |
-1.5553 |
1.2718 |
|
1.2674 |
-0.1247 |
-1.5553 |
| C5 |
-0.0656 |
-1.5553 |
-1.2718 |
|
-1.2735 |
-0.0063 |
-1.5553 |
| H6 |
-1.1486 |
-1.5301 |
1.3066 |
|
1.2517 |
-1.2082 |
-1.5301 |
| H7 |
0.2550 |
-2.5940 |
1.2993 |
|
1.3097 |
0.1942 |
-2.5940 |
| H8 |
0.3178 |
-1.0551 |
2.1520 |
|
2.1644 |
0.2173 |
-1.0551 |
| H9 |
-1.1486 |
-1.5301 |
-1.3066 |
|
-1.3586 |
-1.0865 |
-1.5301 |
| H10 |
0.2550 |
-2.5940 |
-1.2993 |
|
-1.2860 |
0.3152 |
-2.5940 |
| H11 |
0.3178 |
-1.0551 |
-2.1520 |
|
-2.1348 |
0.4176 |
-1.0551 |
Atom - Atom Distances (Å)
| |
C1 |
Br2 |
H3 |
C4 |
C5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
| C1 |
| 1.9840 |
1.0794 |
1.5185 |
1.5185 |
2.1576 |
2.1389 |
2.1612 |
2.1576 |
2.1389 |
2.1612 |
| Br2 |
1.9840 |
| 2.4637 |
2.8627 |
2.8627 |
3.0543 |
3.8438 |
3.0067 |
3.0543 |
3.8438 |
3.0067 |
| H3 |
1.0794 |
2.4637 |
| 2.1528 |
2.1528 |
3.0526 |
2.5083 |
2.4768 |
3.0526 |
2.5083 |
2.4768 |
| C4 |
1.5185 |
2.8627 |
2.1528 |
| 2.5436 |
1.0839 |
1.0873 |
1.0825 |
2.7967 |
2.7914 |
3.4813 |
| C5 |
1.5185 |
2.8627 |
2.1528 |
2.5436 |
| 2.7967 |
2.7914 |
3.4813 |
1.0839 |
1.0873 |
1.0825 |
| H6 |
2.1576 |
3.0543 |
3.0526 |
1.0839 |
2.7967 |
| 1.7612 |
1.7580 |
2.6132 |
3.1452 |
3.7865 |
| H7 |
2.1389 |
3.8438 |
2.5083 |
1.0873 |
2.7914 |
1.7612 |
| 1.7604 |
3.1452 |
2.5985 |
3.7793 |
| H8 |
2.1612 |
3.0067 |
2.4768 |
1.0825 |
3.4813 |
1.7580 |
1.7604 |
| 3.7865 |
3.7793 |
4.3039 |
| H9 |
2.1576 |
3.0543 |
3.0526 |
2.7967 |
1.0839 |
2.6132 |
3.1452 |
3.7865 |
| 1.7612 |
1.7580 |
| H10 |
2.1389 |
3.8438 |
2.5083 |
2.7914 |
1.0873 |
3.1452 |
2.5985 |
3.7793 |
1.7612 |
| 1.7604 |
| H11 |
2.1612 |
3.0067 |
2.4768 |
3.4813 |
1.0825 |
3.7865 |
3.7793 |
4.3039 |
1.7580 |
1.7604 |
|
Maximum atom distance is 4.3039Å
between atoms H8 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
Br2 |
C1 |
C4 |
108.915 |
|
Br2 |
C1 |
C5 |
108.915 |
|
C4 |
C1 |
C5 |
113.769 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C4 |
H6 |
110.907 |
|
C1 |
C4 |
H7 |
109.220 |
|
C1 |
C4 |
H8 |
111.282 |
|
C1 |
C5 |
H9 |
110.907 |
|
C1 |
C5 |
H10 |
109.220 |
|
C1 |
C5 |
H11 |
111.282 |
|
Br2 |
C1 |
H3 |
103.071 |
|
H3 |
C1 |
C4 |
110.797 |
|
H3 |
C1 |
C5 |
110.797 |
|
H6 |
C4 |
H7 |
108.422 |
|
H6 |
C4 |
H8 |
108.485 |
|
H7 |
C4 |
H8 |
108.447 |
|
H9 |
C5 |
H10 |
108.422 |
|
H9 |
C5 |
H11 |
108.485 |
|
H10 |
C5 |
H11 |
108.447 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.