|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COCH3 (Acetone)
1A1 C2V
1910171554
InChI=1S/C3H6O/c1-3(2)4/h1-2H3 INChIKey=CSCPPACGZOOCGX-UHFFFAOYSA-N
M06-2X/6-31G**
Point group is C2
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.1857 |
|
0.1857 |
-0.0000 |
0.0000 |
| O2 |
0.0000 |
0.0000 |
1.3950 |
|
1.3950 |
-0.0000 |
0.0000 |
| C3 |
0.0000 |
1.2874 |
-0.6131 |
|
-0.6131 |
0.0000 |
1.2874 |
| C4 |
0.0000 |
-1.2874 |
-0.6131 |
|
-0.6131 |
0.0000 |
-1.2874 |
| H5 |
-0.0004 |
2.1397 |
0.0654 |
|
0.0654 |
-0.0004 |
2.1397 |
| H6 |
0.0004 |
-2.1397 |
0.0654 |
|
0.0654 |
0.0004 |
-2.1397 |
| H7 |
0.8806 |
1.3288 |
-1.2616 |
|
-1.2616 |
0.8806 |
1.3288 |
| H8 |
-0.8799 |
1.3285 |
-1.2625 |
|
-1.2625 |
-0.8799 |
1.3285 |
| H9 |
-0.8806 |
-1.3288 |
-1.2616 |
|
-1.2616 |
-0.8806 |
-1.3288 |
| H10 |
0.8799 |
-1.3285 |
-1.2625 |
|
-1.2625 |
0.8799 |
-1.3285 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
|
1.2093 |
1.5151 |
1.5151 |
2.1431 |
2.1431 |
2.1531 |
2.1532 |
2.1531 |
2.1532 |
| O2 |
1.2093 |
| 2.3853 |
2.3853 |
2.5191 |
2.5191 |
3.0982 |
3.0986 |
3.0982 |
3.0986 |
| C3 |
1.5151 |
2.3853 |
| 2.5749 |
1.0893 |
3.4936 |
1.0944 |
1.0944 |
2.8356 |
2.8353 |
| C4 |
1.5151 |
2.3853 |
2.5749 |
| 3.4936 |
1.0893 |
2.8356 |
2.8353 |
1.0944 |
1.0944 |
| H5 |
2.1431 |
2.5191 |
1.0893 |
3.4936 |
| 4.2793 |
1.7874 |
1.7875 |
3.8165 |
3.8166 |
| H6 |
2.1431 |
2.5191 |
3.4936 |
1.0893 |
4.2793 |
| 3.8165 |
3.8166 |
1.7874 |
1.7875 |
| H7 |
2.1531 |
3.0982 |
1.0944 |
2.8356 |
1.7874 |
3.8165 |
| 1.7605 |
3.1882 |
2.6572 |
| H8 |
2.1532 |
3.0986 |
1.0944 |
2.8353 |
1.7875 |
3.8166 |
1.7605 |
| 2.6572 |
3.1869 |
| H9 |
2.1531 |
3.0982 |
2.8356 |
1.0944 |
3.8165 |
1.7874 |
3.1882 |
2.6572 |
| 1.7605 |
| H10 |
2.1532 |
3.0986 |
2.8353 |
1.0944 |
3.8166 |
1.7875 |
2.6572 |
3.1869 |
1.7605 |
|
Maximum atom distance is 4.2793Å
between atoms H5 and H6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
C1 |
C3 |
121.816 |
|
O2 |
C1 |
C4 |
121.816 |
|
C3 |
C1 |
C4 |
116.369 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H5 |
109.661 |
|
C1 |
C3 |
H7 |
110.151 |
|
C1 |
C3 |
H8 |
110.164 |
|
C1 |
C4 |
H6 |
109.661 |
|
C1 |
C4 |
H9 |
110.151 |
|
C1 |
C4 |
H10 |
110.164 |
|
H5 |
C3 |
H7 |
109.868 |
|
H5 |
C3 |
H8 |
109.875 |
|
H6 |
C4 |
H9 |
109.868 |
|
H6 |
C4 |
H10 |
109.875 |
|
H7 |
C3 |
H8 |
107.087 |
|
H9 |
C4 |
H10 |
107.087 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.