|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COCH3 (Acetone)
1A C2
1910171554
InChI=1S/C3H6O/c1-3(2)4/h1-2H3 INChIKey=CSCPPACGZOOCGX-UHFFFAOYSA-N
wB97X-D/TZVP
Point group is C2
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.1906 |
|
0.1785 |
-0.0669 |
0.0000 |
| O2 |
0.0000 |
0.0000 |
1.3936 |
|
1.3049 |
-0.4891 |
0.0000 |
| C3 |
0.0000 |
1.2840 |
-0.6139 |
|
-1.0255 |
-0.9868 |
0.0000 |
| C4 |
0.0000 |
-1.2840 |
-0.6139 |
|
-0.1242 |
1.4178 |
-0.0000 |
| H5 |
0.1560 |
2.1350 |
0.0457 |
|
-0.7066 |
-2.0152 |
0.1560 |
| H6 |
-0.1560 |
-2.1350 |
0.0457 |
|
0.7921 |
1.9832 |
-0.1560 |
| H7 |
0.7729 |
1.2589 |
-1.3850 |
|
-1.7388 |
-0.6927 |
0.7729 |
| H8 |
-0.9611 |
1.3928 |
-1.1233 |
|
-1.5407 |
-0.9099 |
-0.9611 |
| H9 |
-0.7729 |
-1.2589 |
-1.3850 |
|
-0.8551 |
1.6650 |
-0.7729 |
| H10 |
0.9611 |
-1.3928 |
-1.1233 |
|
-0.5630 |
1.6985 |
0.9611 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
|
1.2030 |
1.5153 |
1.5153 |
2.1456 |
2.1456 |
2.1599 |
2.1425 |
2.1599 |
2.1425 |
| O2 |
1.2030 |
| 2.3830 |
2.3830 |
2.5297 |
2.5297 |
3.1469 |
3.0329 |
3.1469 |
3.0329 |
| C3 |
1.5153 |
2.3830 |
| 2.5680 |
1.0880 |
3.4856 |
1.0921 |
1.0931 |
2.7674 |
2.8894 |
| C4 |
1.5153 |
2.3830 |
2.5680 |
| 3.4856 |
1.0880 |
2.7674 |
2.8894 |
1.0921 |
1.0931 |
| H5 |
2.1456 |
2.5297 |
1.0880 |
3.4856 |
| 4.2815 |
1.7875 |
1.7791 |
3.7985 |
3.8027 |
| H6 |
2.1456 |
2.5297 |
3.4856 |
1.0880 |
4.2815 |
| 3.7985 |
3.8027 |
1.7875 |
1.7791 |
| H7 |
2.1599 |
3.1469 |
1.0921 |
2.7674 |
1.7875 |
3.7985 |
| 1.7587 |
2.9545 |
2.6713 |
| H8 |
2.1425 |
3.0329 |
1.0931 |
2.8894 |
1.7791 |
3.8027 |
1.7587 |
| 2.6713 |
3.3844 |
| H9 |
2.1599 |
3.1469 |
2.7674 |
1.0921 |
3.7985 |
1.7875 |
2.9545 |
2.6713 |
| 1.7587 |
| H10 |
2.1425 |
3.0329 |
2.8894 |
1.0931 |
3.8027 |
1.7791 |
2.6713 |
3.3844 |
1.7587 |
|
Maximum atom distance is 4.2815Å
between atoms H5 and H6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
C1 |
C3 |
122.071 |
|
O2 |
C1 |
C4 |
122.071 |
|
C3 |
C1 |
C4 |
115.858 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H5 |
109.934 |
|
C1 |
C3 |
H7 |
110.821 |
|
C1 |
C3 |
H8 |
109.377 |
|
C1 |
C4 |
H6 |
109.934 |
|
C1 |
C4 |
H9 |
110.821 |
|
C1 |
C4 |
H10 |
109.377 |
|
H5 |
C3 |
H7 |
110.158 |
|
H5 |
C3 |
H8 |
109.311 |
|
H6 |
C4 |
H9 |
110.158 |
|
H6 |
C4 |
H10 |
109.311 |
|
H7 |
C3 |
H8 |
107.186 |
|
H9 |
C4 |
H10 |
107.186 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.