|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHBr2F (dibromofluoromethane)
1A' CS
1910171554
InChI=1S/CHBr2F/c2-1(3)4/h1H INChIKey=LTUTVFXOEGMHMP-UHFFFAOYSA-N
MP3/TZVP
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.1019 |
0.7827 |
0.0000 |
|
-0.3424 |
0.7038 |
-0.1019 |
| H2 |
-1.0040 |
1.3775 |
0.0000 |
|
-0.6027 |
1.2386 |
-1.0040 |
| F3 |
0.9719 |
1.5884 |
0.0000 |
|
-0.6950 |
1.4283 |
0.9719 |
| Br4 |
-0.1019 |
-0.2910 |
1.6122 |
|
1.5770 |
0.4437 |
-0.1019 |
| Br5 |
-0.1019 |
-0.2910 |
-1.6122 |
|
-1.3223 |
-0.9670 |
-0.1019 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
F3 |
Br4 |
Br5 |
| C1 |
|
1.0806 |
1.3425 |
1.9369 |
1.9369 |
| H2 |
1.0806 |
| 1.9872 |
2.4893 |
2.4893 |
| F3 |
1.3425 |
1.9872 |
| 2.6989 |
2.6989 |
| Br4 |
1.9369 |
2.4893 |
2.6989 |
| 3.2243 |
| Br5 |
1.9369 |
2.4893 |
2.6989 |
3.2243 |
|
Maximum atom distance is 3.2243Å
between atoms Br4 and Br5.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
F3 |
C1 |
Br4 |
109.431 |
|
F3 |
C1 |
Br5 |
109.431 |
|
Br4 |
C1 |
Br5 |
112.674 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
F3 |
109.719 |
|
H2 |
C1 |
Br4 |
107.766 |
|
H2 |
C1 |
Br5 |
107.766 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.