|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CFClCClF (trans-1,2-dichloro-1,2-difluoroethylene)
1AG C2H
1910171554
InChI=1S/C2Cl2F2/c3-1(5)2(4)6/b2-1+ INChIKey=UPVJEODAZWTJKZ-OWOJBTEDSA-N
MP2=FULL/TZVP
Point group is C2h
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.0619 |
0.6635 |
0.0000 |
|
0.6067 |
0.2755 |
0.0000 |
| C2 |
0.0619 |
-0.6635 |
0.0000 |
|
-0.6067 |
-0.2755 |
0.0000 |
| F3 |
-1.2607 |
1.2378 |
0.0000 |
|
1.7002 |
-0.4803 |
0.0000 |
| F4 |
1.2607 |
-1.2378 |
0.0000 |
|
-1.7002 |
0.4803 |
0.0000 |
| Cl5 |
1.2607 |
1.7466 |
0.0000 |
|
0.8910 |
1.9612 |
0.0000 |
| Cl6 |
-1.2607 |
-1.7466 |
0.0000 |
|
-0.8910 |
-1.9612 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
F3 |
F4 |
Cl5 |
Cl6 |
| C1 |
|
1.3327 |
1.3293 |
2.3161 |
1.7095 |
2.6918 |
| C2 |
1.3327 |
| 2.3161 |
1.3293 |
2.6918 |
1.7095 |
| F3 |
1.3293 |
2.3161 |
| 3.5336 |
2.5721 |
2.9845 |
| F4 |
2.3161 |
1.3293 |
3.5336 |
| 2.9845 |
2.5721 |
| Cl5 |
1.7095 |
2.6918 |
2.5721 |
2.9845 |
| 4.3081 |
| Cl6 |
2.6918 |
1.7095 |
2.9845 |
2.5721 |
4.3081 |
|
Maximum atom distance is 4.3081Å
between atoms Cl5 and Cl6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
F4 |
120.927 |
|
C1 |
C2 |
Cl6 |
123.990 |
|
C2 |
C1 |
F3 |
120.927 |
|
C2 |
C1 |
Cl5 |
123.990 |
|
F3 |
C1 |
Cl5 |
115.082 |
|
F4 |
C2 |
Cl6 |
115.082 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.