|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3NO3 (Methyl nitrate)
1A' CS
1910171554
InChI=1S/CH3NO3/c1-5-2(3)4/h1H3 INChIKey=LRMHVVPPGGOAJQ-UHFFFAOYSA-N
B3LYP/TZVP
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| N1 |
0.0000 |
0.6296 |
0.0000 |
|
0.6280 |
-0.0450 |
0.0000 |
| O2 |
-1.2061 |
0.5752 |
0.0000 |
|
0.4875 |
-1.2442 |
0.0000 |
| O3 |
0.7278 |
1.5803 |
0.0000 |
|
1.6283 |
0.6128 |
0.0000 |
| O4 |
0.7110 |
-0.6102 |
0.0000 |
|
-0.5577 |
0.7529 |
0.0000 |
| C5 |
-0.1466 |
-1.7649 |
0.0000 |
|
-1.7709 |
-0.0199 |
0.0000 |
| H6 |
0.5558 |
-2.5956 |
0.0000 |
|
-2.5491 |
0.7401 |
0.0000 |
| H7 |
-0.7691 |
-1.7922 |
0.8934 |
|
-1.8427 |
-0.6389 |
0.8934 |
| H8 |
-0.7691 |
-1.7922 |
-0.8934 |
|
-1.8427 |
-0.6389 |
-0.8934 |
Atom - Atom Distances (Å)
| |
N1 |
O2 |
O3 |
O4 |
C5 |
H6 |
H7 |
H8 |
| N1 |
|
1.2073 |
1.1973 |
1.4292 |
2.3990 |
3.2727 |
2.6935 |
2.6935 |
| O2 |
1.2073 |
| 2.1794 |
2.2540 |
2.5689 |
3.6275 |
2.5679 |
2.5679 |
| O3 |
1.1973 |
2.1794 |
| 2.1905 |
3.4576 |
4.1794 |
3.7964 |
3.7964 |
| O4 |
1.4292 |
2.2540 |
2.1905 |
|
1.4384 |
1.9914 |
2.0943 |
2.0943 |
| C5 |
2.3990 |
2.5689 |
3.4576 |
1.4384 |
|
1.0878 |
1.0892 |
1.0892 |
| H6 |
3.2727 |
3.6275 |
4.1794 |
1.9914 |
1.0878 |
| 1.7886 |
1.7886 |
| H7 |
2.6935 |
2.5679 |
3.7964 |
2.0943 |
1.0892 |
1.7886 |
| 1.7868 |
| H8 |
2.6935 |
2.5679 |
3.7964 |
2.0943 |
1.0892 |
1.7886 |
1.7868 |
|
Maximum atom distance is 4.1794Å
between atoms O3 and H6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
N1 |
O4 |
C5 |
113.564 |
|
O2 |
N1 |
O3 |
130.014 |
|
O2 |
N1 |
O4 |
117.257 |
|
O3 |
N1 |
O4 |
112.730 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O4 |
C5 |
H6 |
103.180 |
|
O4 |
C5 |
H7 |
111.153 |
|
O4 |
C5 |
H8 |
111.153 |
|
H6 |
C5 |
H7 |
110.482 |
|
H6 |
C5 |
H8 |
110.482 |
|
H7 |
C5 |
H8 |
110.211 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.