|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHBrCl2 (Methane, bromodichloro-)
1A' CS
1910171554
InChI=1S/CHBrCl2/c2-1(3)4/h1H INChIKey=FMWLUWPQPKEARP-UHFFFAOYSA-N
wB97X-D/daug-cc-pVTZ
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.6692 |
-0.1347 |
0.0000 |
|
0.3753 |
-0.5540 |
-0.1347 |
| H2 |
-1.5748 |
0.4544 |
0.0000 |
|
0.8833 |
-1.3037 |
0.4544 |
| Br3 |
0.8098 |
1.1102 |
0.0000 |
|
-0.4542 |
0.6704 |
1.1102 |
| Cl4 |
-0.6692 |
-1.1324 |
1.4585 |
|
1.5828 |
0.2641 |
-1.1324 |
| Cl5 |
-0.6692 |
-1.1324 |
-1.4585 |
|
-0.8321 |
-1.3721 |
-1.1324 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
Br3 |
Cl4 |
Cl5 |
| C1 |
|
1.0804 |
1.9331 |
1.7671 |
1.7671 |
| H2 |
1.0804 |
| 2.4731 |
2.3379 |
2.3379 |
| Br3 |
1.9331 |
2.4731 |
| 3.0568 |
3.0568 |
| Cl4 |
1.7671 |
2.3379 |
3.0568 |
| 2.9170 |
| Cl5 |
1.7671 |
2.3379 |
3.0568 |
2.9170 |
|
Maximum atom distance is 3.0568Å
between atoms Br3 and Cl4.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
Br3 |
C1 |
Cl4 |
111.322 |
|
Br3 |
C1 |
Cl5 |
111.322 |
|
Cl4 |
C1 |
Cl5 |
111.249 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
Br3 |
106.866 |
|
H2 |
C1 |
Cl4 |
107.932 |
|
H2 |
C1 |
Cl5 |
107.932 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.