|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for ClCOClCO (Oxalyl chloride)
1AG C2H
1910171554
InChI=1S/C2Cl2O2/c3-1(5)2(4)6 INChIKey=CTSLXHKWHWQRSH-UHFFFAOYSA-N
HF/Def2TZVPP
Point group is C2h
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.0940 |
0.7314 |
0.0000 |
|
0.6783 |
0.2895 |
0.0000 |
| C2 |
0.0940 |
-0.7314 |
0.0000 |
|
-0.6783 |
-0.2895 |
0.0000 |
| O3 |
-1.2683 |
1.2188 |
0.0000 |
|
1.6933 |
-0.4763 |
0.0000 |
| O4 |
1.2683 |
-1.2188 |
0.0000 |
|
-1.6933 |
0.4763 |
0.0000 |
| Cl5 |
1.2683 |
1.7877 |
0.0000 |
|
0.8991 |
1.9990 |
0.0000 |
| Cl6 |
-1.2683 |
-1.7877 |
0.0000 |
|
-0.8991 |
-1.9990 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
O3 |
O4 |
Cl5 |
Cl6 |
| C1 |
|
1.4749 |
1.2714 |
2.3789 |
1.7238 |
2.7794 |
| C2 |
1.4749 |
| 2.3789 |
1.2714 |
2.7794 |
1.7238 |
| O3 |
1.2714 |
2.3789 |
| 3.5179 |
2.5996 |
3.0065 |
| O4 |
2.3789 |
1.2714 |
3.5179 |
| 3.0065 |
2.5996 |
| Cl5 |
1.7238 |
2.7794 |
2.5996 |
3.0065 |
| 4.3838 |
| Cl6 |
2.7794 |
1.7238 |
3.0065 |
2.5996 |
4.3838 |
|
Maximum atom distance is 4.3838Å
between atoms Cl5 and Cl6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
O4 |
119.858 |
|
C1 |
C2 |
Cl6 |
120.470 |
|
C2 |
C1 |
O3 |
119.858 |
|
C2 |
C1 |
Cl5 |
120.470 |
|
O3 |
C1 |
Cl5 |
119.672 |
|
O4 |
C2 |
Cl6 |
119.672 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.