|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COCH3 (Acetone)
1A1 C2V
1910171554
InChI=1S/C3H6O/c1-3(2)4/h1-2H3 INChIKey=CSCPPACGZOOCGX-UHFFFAOYSA-N
MP2/Def2TZVPP
Point group is C2
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.1832 |
|
0.1832 |
0.0000 |
0.0000 |
| O2 |
0.0000 |
0.0000 |
1.4004 |
|
1.4004 |
0.0000 |
0.0000 |
| C3 |
0.0000 |
1.2809 |
-0.6142 |
|
-0.6142 |
1.1514 |
0.5612 |
| C4 |
0.0000 |
-1.2809 |
-0.6142 |
|
-0.6142 |
-1.1514 |
-0.5612 |
| H5 |
0.0018 |
2.1342 |
0.0558 |
|
0.0558 |
1.9176 |
0.9368 |
| H6 |
-0.0018 |
-2.1342 |
0.0558 |
|
0.0558 |
-1.9176 |
-0.9368 |
| H7 |
0.8753 |
1.3148 |
-1.2625 |
|
-1.2625 |
0.7983 |
1.3629 |
| H8 |
-0.8777 |
1.3164 |
-1.2592 |
|
-1.2592 |
1.5679 |
-0.2121 |
| H9 |
-0.8753 |
-1.3148 |
-1.2625 |
|
-1.2625 |
-0.7983 |
-1.3629 |
| H10 |
0.8777 |
-1.3164 |
-1.2592 |
|
-1.2592 |
-1.5679 |
0.2121 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
|
1.2172 |
1.5088 |
1.5088 |
2.1380 |
2.1380 |
2.1412 |
2.1410 |
2.1412 |
2.1410 |
| O2 |
1.2172 |
| 2.3873 |
2.3873 |
2.5225 |
2.5225 |
3.0961 |
3.0946 |
3.0961 |
3.0946 |
| C3 |
1.5088 |
2.3873 |
| 2.5618 |
1.0849 |
3.4802 |
1.0898 |
1.0898 |
2.8150 |
2.8164 |
| C4 |
1.5088 |
2.3873 |
2.5618 |
| 3.4802 |
1.0849 |
2.8150 |
2.8164 |
1.0898 |
1.0898 |
| H5 |
2.1380 |
2.5225 |
1.0849 |
3.4802 |
| 4.2684 |
1.7810 |
1.7809 |
3.7951 |
3.7951 |
| H6 |
2.1380 |
2.5225 |
3.4802 |
1.0849 |
4.2684 |
| 3.7951 |
3.7951 |
1.7810 |
1.7809 |
| H7 |
2.1412 |
3.0961 |
1.0898 |
2.8150 |
1.7810 |
3.7951 |
| 1.7530 |
3.1591 |
2.6312 |
| H8 |
2.1410 |
3.0946 |
1.0898 |
2.8164 |
1.7809 |
3.7951 |
1.7530 |
| 2.6312 |
3.1643 |
| H9 |
2.1412 |
3.0961 |
2.8150 |
1.0898 |
3.7951 |
1.7810 |
3.1591 |
2.6312 |
| 1.7530 |
| H10 |
2.1410 |
3.0946 |
2.8164 |
1.0898 |
3.7951 |
1.7809 |
2.6312 |
3.1643 |
1.7530 |
|
Maximum atom distance is 4.2684Å
between atoms H5 and H6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
C1 |
C3 |
121.904 |
|
O2 |
C1 |
C4 |
121.904 |
|
C3 |
C1 |
C4 |
116.192 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H5 |
109.958 |
|
C1 |
C3 |
H7 |
109.925 |
|
C1 |
C3 |
H8 |
109.904 |
|
C1 |
C4 |
H6 |
109.958 |
|
C1 |
C4 |
H9 |
109.925 |
|
C1 |
C4 |
H10 |
109.904 |
|
H5 |
C3 |
H7 |
109.968 |
|
H5 |
C3 |
H8 |
109.954 |
|
H6 |
C4 |
H9 |
109.968 |
|
H6 |
C4 |
H10 |
109.954 |
|
H7 |
C3 |
H8 |
107.088 |
|
H9 |
C4 |
H10 |
107.088 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.