|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C2H5NO3 (Nitric acid, ethyl ester)
1A' C1
1910171554
InChI=1S/C2H5NO3/c1-2-6-3(4)5/h2H2,1H3 INChIKey=IDNUEBSJWINEMI-UHFFFAOYSA-N
MP2/Def2TZVPP
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| N1 |
1.0913 |
-0.2719 |
0.0000 |
|
1.1235 |
0.0493 |
0.0000 |
| O2 |
0.0000 |
0.5528 |
0.0000 |
|
-0.1570 |
0.5300 |
0.0000 |
| O3 |
2.1373 |
0.3221 |
0.0000 |
|
1.9578 |
0.9159 |
0.0000 |
| O4 |
0.8829 |
-1.4651 |
0.0000 |
|
1.2627 |
-1.1540 |
0.0000 |
| C5 |
-1.2581 |
-0.1526 |
0.0000 |
|
-1.1630 |
-0.5036 |
0.0000 |
| C6 |
-2.3135 |
0.9244 |
0.0000 |
|
-2.4808 |
0.2293 |
0.0000 |
| H7 |
-1.3120 |
-0.7820 |
0.8847 |
|
-1.0359 |
-1.1224 |
0.8847 |
| H8 |
-1.3120 |
-0.7820 |
-0.8847 |
|
-1.0359 |
-1.1224 |
-0.8847 |
| H9 |
-3.2960 |
0.4576 |
0.0000 |
|
-3.2903 |
-0.4975 |
0.0000 |
| H10 |
-2.2252 |
1.5499 |
0.8841 |
|
-2.5738 |
0.8541 |
0.8841 |
| H11 |
-2.2252 |
1.5499 |
-0.8841 |
|
-2.5738 |
0.8541 |
-0.8841 |
Atom - Atom Distances (Å)
| |
N1 |
O2 |
O3 |
O4 |
C5 |
C6 |
H7 |
H8 |
H9 |
H10 |
H11 |
| N1 |
|
1.3678 |
1.2029 |
1.2112 |
2.3524 |
3.6088 |
2.6112 |
2.6112 |
4.4475 |
3.8859 |
3.8859 |
| O2 |
1.3678 |
| 2.1497 |
2.2025 |
1.4423 |
2.3431 |
2.0701 |
2.0701 |
3.2974 |
2.5938 |
2.5938 |
| O3 |
1.2029 |
2.1497 |
| 2.1834 |
3.4284 |
4.4913 |
3.7281 |
3.7281 |
5.4350 |
4.6174 |
4.6174 |
| O4 |
1.2112 |
2.2025 |
2.1834 |
| 2.5113 |
3.9908 |
2.4631 |
2.4631 |
4.6000 |
4.4196 |
4.4196 |
| C5 |
2.3524 |
1.4423 |
3.4284 |
2.5113 |
|
1.5079 |
1.0871 |
1.0871 |
2.1273 |
2.1484 |
2.1484 |
| C6 |
3.6088 |
2.3431 |
4.4913 |
3.9908 |
1.5079 |
| 2.1673 |
2.1673 |
1.0878 |
1.0866 |
1.0866 |
| H7 |
2.6112 |
2.0701 |
3.7281 |
2.4631 |
1.0871 |
2.1673 |
| 1.7693 |
2.5011 |
2.5043 |
3.0660 |
| H8 |
2.6112 |
2.0701 |
3.7281 |
2.4631 |
1.0871 |
2.1673 |
1.7693 |
| 2.5011 |
3.0660 |
2.5043 |
| H9 |
4.4475 |
3.2974 |
5.4350 |
4.6000 |
2.1273 |
1.0878 |
2.5011 |
2.5011 |
| 1.7668 |
1.7668 |
| H10 |
3.8859 |
2.5938 |
4.6174 |
4.4196 |
2.1484 |
1.0866 |
2.5043 |
3.0660 |
1.7668 |
| 1.7683 |
| H11 |
3.8859 |
2.5938 |
4.6174 |
4.4196 |
2.1484 |
1.0866 |
3.0660 |
2.5043 |
1.7668 |
1.7683 |
|
Maximum atom distance is 5.4350Å
between atoms O3 and H9.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
N1 |
O2 |
C5 |
113.646 |
|
O2 |
N1 |
O3 |
113.332 |
|
O2 |
N1 |
O4 |
117.173 |
|
O2 |
C5 |
C6 |
105.142 |
|
O3 |
N1 |
O4 |
129.496 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
C5 |
H7 |
109.049 |
|
O2 |
C5 |
H8 |
109.049 |
|
C5 |
C6 |
H9 |
109.002 |
|
C5 |
C6 |
H10 |
110.752 |
|
C5 |
C6 |
H11 |
110.752 |
|
C6 |
C5 |
H7 |
112.263 |
|
C6 |
C5 |
H8 |
112.263 |
|
H7 |
C5 |
H8 |
108.943 |
|
H9 |
C6 |
H10 |
108.687 |
|
H9 |
C6 |
H11 |
108.687 |
|
H10 |
C6 |
H11 |
108.910 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.