|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHFClCHClF (ethane, 1,2-dichloro-1,2-difluoro-)
1AG CI
1910171554
InChI=1S/C2H2Cl2F2/c3-1(5)2(4)6/h1-2H/t1-,2+ INChIKey=IDSKMUOSMAUASS-XIXRPRMCSA-N
MP3/6-31+G**
Point group is Ci
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
-0.7618 |
|
-0.5867 |
0.2971 |
-0.3845 |
| C2 |
0.0000 |
0.0000 |
0.7618 |
|
0.5867 |
-0.2971 |
0.3845 |
| H3 |
1.0103 |
0.0000 |
-1.1587 |
|
-1.1370 |
1.0110 |
0.2204 |
| H4 |
-1.0103 |
0.0000 |
1.1587 |
|
1.1370 |
-1.0110 |
-0.2204 |
| F5 |
-0.6488 |
-1.1319 |
-1.1880 |
|
-0.0899 |
0.9375 |
-1.4922 |
| F6 |
0.6488 |
1.1319 |
1.1880 |
|
0.0899 |
-0.9375 |
1.4922 |
| Cl7 |
-0.8566 |
1.4175 |
-1.3693 |
|
-1.6837 |
-0.9832 |
-0.9037 |
| Cl8 |
0.8566 |
-1.4175 |
1.3693 |
|
1.6837 |
0.9832 |
0.9037 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
H3 |
H4 |
F5 |
F6 |
Cl7 |
Cl8 |
| C1 |
|
1.5236 |
1.0855 |
2.1701 |
1.3726 |
2.3461 |
1.7641 |
2.6990 |
| C2 |
1.5236 |
| 2.1701 |
1.0855 |
2.3461 |
1.3726 |
2.6990 |
1.7641 |
| H3 |
1.0855 |
2.1701 |
| 3.0747 |
2.0087 |
2.6304 |
2.3535 |
2.9024 |
| H4 |
2.1701 |
1.0855 |
3.0747 |
| 2.6304 |
2.0087 |
2.9024 |
2.3535 |
| F5 |
1.3726 |
2.3461 |
2.0087 |
2.6304 |
| 3.5291 |
2.5643 |
2.9813 |
| F6 |
2.3461 |
1.3726 |
2.6304 |
2.0087 |
3.5291 |
| 2.9813 |
2.5643 |
| Cl7 |
1.7641 |
2.6990 |
2.3535 |
2.9024 |
2.5643 |
2.9813 |
| 4.2979 |
| Cl8 |
2.6990 |
1.7641 |
2.9024 |
2.3535 |
2.9813 |
2.5643 |
4.2979 |
|
Maximum atom distance is 4.2979Å
between atoms Cl7 and Cl8.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
F6 |
108.091 |
|
C1 |
C2 |
Cl8 |
110.144 |
|
C2 |
C1 |
F5 |
108.091 |
|
C2 |
C1 |
Cl7 |
110.144 |
|
F5 |
C1 |
Cl7 |
109.036 |
|
F6 |
C2 |
Cl8 |
109.036 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H4 |
111.448 |
|
C2 |
C1 |
H3 |
111.448 |
|
H3 |
C1 |
F5 |
109.054 |
|
H3 |
C1 |
Cl7 |
109.027 |
|
H4 |
C2 |
F6 |
109.054 |
|
H4 |
C2 |
Cl8 |
109.027 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.