|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C6N4 (Tetracyanoethylene)
1AG D2H
1910171554
InChI=1S/C6N4/c7-1-5(2-8)6(3-9)4-10 INChIKey=NLDYACGHTUPAQU-UHFFFAOYSA-N
MP3/6-31+G**
Point group is D2h
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.6788 |
|
0.6788 |
0.0000 |
0.0000 |
| C2 |
0.0000 |
0.0000 |
-0.6788 |
|
-0.6788 |
0.0000 |
0.0000 |
| C3 |
0.0000 |
1.2279 |
1.4367 |
|
1.4367 |
1.2279 |
0.0000 |
| C4 |
0.0000 |
-1.2279 |
1.4367 |
|
1.4367 |
-1.2279 |
0.0000 |
| C5 |
0.0000 |
1.2279 |
-1.4367 |
|
-1.4367 |
1.2279 |
0.0000 |
| C6 |
0.0000 |
-1.2279 |
-1.4367 |
|
-1.4367 |
-1.2279 |
0.0000 |
| N7 |
0.0000 |
2.2078 |
2.0554 |
|
2.0554 |
2.2078 |
0.0000 |
| N8 |
0.0000 |
-2.2078 |
2.0554 |
|
2.0554 |
-2.2078 |
0.0000 |
| N9 |
0.0000 |
2.2078 |
-2.0554 |
|
-2.0554 |
2.2078 |
0.0000 |
| N10 |
0.0000 |
-2.2078 |
-2.0554 |
|
-2.0554 |
-2.2078 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
C4 |
C5 |
C6 |
N7 |
N8 |
N9 |
N10 |
| C1 |
|
1.3577 |
1.4429 |
1.4429 |
2.4461 |
2.4461 |
2.6018 |
2.6018 |
3.5143 |
3.5143 |
| C2 |
1.3577 |
| 2.4461 |
2.4461 |
1.4429 |
1.4429 |
3.5143 |
3.5143 |
2.6018 |
2.6018 |
| C3 |
1.4429 |
2.4461 |
| 2.4558 |
2.8734 |
3.7799 |
1.1589 |
3.4910 |
3.6270 |
4.8989 |
| C4 |
1.4429 |
2.4461 |
2.4558 |
| 3.7799 |
2.8734 |
3.4910 |
1.1589 |
4.8989 |
3.6270 |
| C5 |
2.4461 |
1.4429 |
2.8734 |
3.7799 |
| 2.4558 |
3.6270 |
4.8989 |
1.1589 |
3.4910 |
| C6 |
2.4461 |
1.4429 |
3.7799 |
2.8734 |
2.4558 |
| 4.8989 |
3.6270 |
3.4910 |
1.1589 |
| N7 |
2.6018 |
3.5143 |
1.1589 |
3.4910 |
3.6270 |
4.8989 |
| 4.4156 |
4.1108 |
6.0330 |
| N8 |
2.6018 |
3.5143 |
3.4910 |
1.1589 |
4.8989 |
3.6270 |
4.4156 |
| 6.0330 |
4.1108 |
| N9 |
3.5143 |
2.6018 |
3.6270 |
4.8989 |
1.1589 |
3.4910 |
4.1108 |
6.0330 |
| 4.4156 |
| N10 |
3.5143 |
2.6018 |
4.8989 |
3.6270 |
3.4910 |
1.1589 |
6.0330 |
4.1108 |
4.4156 |
|
Maximum atom distance is 6.0330Å
between atoms N7 and N10.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C5 |
121.682 |
|
C1 |
C2 |
C6 |
121.682 |
|
C1 |
C3 |
N7 |
179.413 |
|
C1 |
C4 |
N8 |
179.413 |
|
C2 |
C1 |
C3 |
121.682 |
|
C2 |
C1 |
C4 |
121.682 |
|
C2 |
C5 |
N9 |
179.413 |
|
C2 |
C6 |
N10 |
179.413 |
|
C3 |
C1 |
C4 |
116.636 |
|
C5 |
C2 |
C6 |
116.636 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.