|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COCH3 (Acetone)
1A1 C2V
1910171554
InChI=1S/C3H6O/c1-3(2)4/h1-2H3 INChIKey=CSCPPACGZOOCGX-UHFFFAOYSA-N
B1B95/6-31+G**
Point group is C2
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.1806 |
|
0.0000 |
0.1806 |
0.0000 |
| O2 |
0.0000 |
0.0000 |
1.3937 |
|
0.0000 |
1.3937 |
0.0000 |
| C3 |
0.0000 |
1.2844 |
-0.6104 |
|
1.2844 |
-0.6104 |
0.0011 |
| C4 |
0.0000 |
-1.2844 |
-0.6104 |
|
-1.2844 |
-0.6104 |
-0.0011 |
| H5 |
0.0939 |
2.1356 |
0.0609 |
|
2.1355 |
0.0609 |
0.0957 |
| H6 |
-0.0939 |
-2.1356 |
0.0609 |
|
-2.1355 |
0.0609 |
-0.0957 |
| H7 |
0.8159 |
1.2904 |
-1.3376 |
|
1.2897 |
-1.3376 |
0.8170 |
| H8 |
-0.9312 |
1.3697 |
-1.1777 |
|
1.3704 |
-1.1777 |
-0.9301 |
| H9 |
-0.8159 |
-1.2904 |
-1.3376 |
|
-1.2897 |
-1.3376 |
-0.8170 |
| H10 |
0.9312 |
-1.3697 |
-1.1777 |
|
-1.3704 |
-1.1777 |
0.9301 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
|
1.2131 |
1.5084 |
1.5084 |
2.1410 |
2.1410 |
2.1531 |
2.1420 |
2.1531 |
2.1420 |
| O2 |
1.2131 |
| 2.3803 |
2.3803 |
2.5191 |
2.5191 |
3.1290 |
3.0586 |
3.1290 |
3.0586 |
| C3 |
1.5084 |
2.3803 |
| 2.5688 |
1.0881 |
3.4865 |
1.0930 |
1.0938 |
2.7971 |
2.8693 |
| C4 |
1.5084 |
2.3803 |
2.5688 |
| 3.4865 |
1.0881 |
2.7971 |
2.8693 |
1.0930 |
1.0938 |
| H5 |
2.1410 |
2.5191 |
1.0881 |
3.4865 |
| 4.2753 |
1.7865 |
1.7809 |
3.8106 |
3.8108 |
| H6 |
2.1410 |
2.5191 |
3.4865 |
1.0881 |
4.2753 |
| 3.8106 |
3.8108 |
1.7865 |
1.7809 |
| H7 |
2.1531 |
3.1290 |
1.0930 |
2.7971 |
1.7865 |
3.8106 |
| 1.7563 |
3.0534 |
2.6673 |
| H8 |
2.1420 |
3.0586 |
1.0938 |
2.8693 |
1.7809 |
3.8108 |
1.7563 |
| 2.6673 |
3.3125 |
| H9 |
2.1531 |
3.1290 |
2.7971 |
1.0930 |
3.8106 |
1.7865 |
3.0534 |
2.6673 |
| 1.7563 |
| H10 |
2.1420 |
3.0586 |
2.8693 |
1.0938 |
3.8108 |
1.7809 |
2.6673 |
3.3125 |
1.7563 |
|
Maximum atom distance is 4.2753Å
between atoms H5 and H6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
C1 |
C3 |
121.627 |
|
O2 |
C1 |
C4 |
121.627 |
|
C3 |
C1 |
C4 |
116.746 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H5 |
110.036 |
|
C1 |
C3 |
H7 |
110.705 |
|
C1 |
C3 |
H8 |
109.778 |
|
C1 |
C4 |
H6 |
110.036 |
|
C1 |
C4 |
H9 |
110.705 |
|
C1 |
C4 |
H10 |
109.778 |
|
H5 |
C3 |
H7 |
109.984 |
|
H5 |
C3 |
H8 |
109.419 |
|
H6 |
C4 |
H9 |
109.984 |
|
H6 |
C4 |
H10 |
109.419 |
|
H7 |
C3 |
H8 |
106.860 |
|
H9 |
C4 |
H10 |
106.860 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.