|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CHBrCH3 (i-propyl bromide)
1A' CS
1910171554
InChI=1S/C3H7Br/c1-3(2)4/h3H,1-2H3 INChIKey=NAMYKGVDVNBCFQ-UHFFFAOYSA-N
QCISD/6-31+G**
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.4653 |
-0.9034 |
0.0000 |
|
-0.9244 |
0.0000 |
0.4220 |
| Br2 |
-0.0669 |
1.0097 |
0.0000 |
|
1.0117 |
0.0000 |
-0.0190 |
| H3 |
1.5533 |
-0.8728 |
0.0000 |
|
-0.9453 |
0.0000 |
1.5102 |
| C4 |
-0.0669 |
-1.5563 |
1.2650 |
|
-1.5514 |
1.2650 |
-0.1404 |
| C5 |
-0.0669 |
-1.5563 |
-1.2650 |
|
-1.5514 |
-1.2650 |
-0.1404 |
| H6 |
-1.1566 |
-1.5112 |
1.2830 |
|
-1.4548 |
1.2830 |
-1.2268 |
| H7 |
0.2388 |
-2.6062 |
1.2823 |
|
-2.6146 |
1.2823 |
0.1152 |
| H8 |
0.3165 |
-1.0679 |
2.1600 |
|
-1.0817 |
2.1600 |
0.2656 |
| H9 |
-1.1566 |
-1.5112 |
-1.2830 |
|
-1.4548 |
-1.2830 |
-1.2268 |
| H10 |
0.2388 |
-2.6062 |
-1.2823 |
|
-2.6146 |
-1.2823 |
0.1152 |
| H11 |
0.3165 |
-1.0679 |
-2.1600 |
|
-1.0817 |
-2.1600 |
0.2656 |
Atom - Atom Distances (Å)
| |
C1 |
Br2 |
H3 |
C4 |
C5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
| C1 |
| 1.9858 |
1.0884 |
1.5198 |
1.5198 |
2.1555 |
2.1436 |
2.1714 |
2.1555 |
2.1436 |
2.1714 |
| Br2 |
1.9858 |
| 2.4837 |
2.8609 |
2.8609 |
3.0312 |
3.8487 |
3.0215 |
3.0312 |
3.8487 |
3.0215 |
| H3 |
1.0884 |
2.4837 |
| 2.1662 |
2.1662 |
3.0655 |
2.5253 |
2.4967 |
3.0655 |
2.5253 |
2.4967 |
| C4 |
1.5198 |
2.8609 |
2.1662 |
| 2.5301 |
1.0908 |
1.0936 |
1.0892 |
2.7716 |
2.7721 |
3.4809 |
| C5 |
1.5198 |
2.8609 |
2.1662 |
2.5301 |
| 2.7716 |
2.7721 |
3.4809 |
1.0908 |
1.0936 |
1.0892 |
| H6 |
2.1555 |
3.0312 |
3.0655 |
1.0908 |
2.7716 |
| 1.7737 |
1.7708 |
2.5659 |
3.1188 |
3.7710 |
| H7 |
2.1436 |
3.8487 |
2.5253 |
1.0936 |
2.7721 |
1.7737 |
| 1.7728 |
3.1188 |
2.5646 |
3.7712 |
| H8 |
2.1714 |
3.0215 |
2.4967 |
1.0892 |
3.4809 |
1.7708 |
1.7728 |
| 3.7710 |
3.7712 |
4.3200 |
| H9 |
2.1555 |
3.0312 |
3.0655 |
2.7716 |
1.0908 |
2.5659 |
3.1188 |
3.7710 |
| 1.7737 |
1.7708 |
| H10 |
2.1436 |
3.8487 |
2.5253 |
2.7721 |
1.0936 |
3.1188 |
2.5646 |
3.7712 |
1.7737 |
| 1.7728 |
| H11 |
2.1714 |
3.0215 |
2.4967 |
3.4809 |
1.0892 |
3.7710 |
3.7712 |
4.3200 |
1.7708 |
1.7728 |
|
Maximum atom distance is 4.3200Å
between atoms H8 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
Br2 |
C1 |
C4 |
108.664 |
|
Br2 |
C1 |
C5 |
108.664 |
|
C4 |
C1 |
C5 |
112.686 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C4 |
H6 |
110.227 |
|
C1 |
C4 |
H7 |
109.128 |
|
C1 |
C4 |
H8 |
111.595 |
|
C1 |
C5 |
H9 |
110.227 |
|
C1 |
C5 |
H10 |
109.128 |
|
C1 |
C5 |
H11 |
111.595 |
|
Br2 |
C1 |
H3 |
103.931 |
|
H3 |
C1 |
C4 |
111.231 |
|
H3 |
C1 |
C5 |
111.231 |
|
H6 |
C4 |
H7 |
108.581 |
|
H6 |
C4 |
H8 |
108.637 |
|
H7 |
C4 |
H8 |
108.609 |
|
H9 |
C5 |
H10 |
108.581 |
|
H9 |
C5 |
H11 |
108.637 |
|
H10 |
C5 |
H11 |
108.609 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.