|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for HOCH2COOH (Hydroxyacetic acid)
1A CS
1910171554
InChI=1S/C2H4O3/c3-1-2(4)5/h3H,1H2,(H,4,5) INChIKey=AEMRFAOFKBGASW-UHFFFAOYSA-N
TPSSh/6-31+G**
Point group is C1
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.7412 |
-0.7512 |
0.0197 |
|
0.7453 |
-0.7471 |
0.0210 |
| C2 |
0.5179 |
0.0999 |
0.0051 |
|
-0.5185 |
0.0971 |
0.0052 |
| O3 |
1.6396 |
-0.6437 |
-0.0153 |
|
-1.6361 |
-0.6526 |
-0.0127 |
| O4 |
0.4985 |
1.3146 |
0.0112 |
|
-0.5056 |
1.3119 |
0.0084 |
| O5 |
-1.8915 |
0.0512 |
-0.0197 |
|
1.8912 |
0.0615 |
-0.0210 |
| H6 |
-0.7067 |
-1.4381 |
-0.8366 |
|
0.7140 |
-1.4363 |
-0.8336 |
| H7 |
-0.7291 |
-1.3646 |
0.9315 |
|
0.7371 |
-1.3584 |
0.9343 |
| H8 |
-1.6058 |
0.9799 |
-0.0365 |
|
1.6004 |
0.9886 |
-0.0398 |
| H9 |
2.4081 |
-0.0470 |
-0.0170 |
|
-2.4078 |
-0.0601 |
-0.0154 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
O3 |
O4 |
O5 |
H6 |
H7 |
H8 |
H9 |
| C1 |
|
1.5199 |
2.3835 |
2.4092 |
1.4030 |
1.0984 |
1.0990 |
1.9358 |
3.2273 |
| C2 |
1.5199 |
|
1.3459 |
1.2148 |
2.4101 |
2.1387 |
2.1350 |
2.2992 |
1.8960 |
| O3 |
2.3835 |
1.3459 |
| 2.2666 |
3.5989 |
2.6098 |
2.6509 |
3.6289 |
0.9729 |
| O4 |
2.4092 |
1.2148 |
2.2666 |
| 2.7035 |
3.1223 |
3.0874 |
2.1313 |
2.3455 |
| O5 |
1.4030 |
2.4101 |
3.5989 |
2.7035 |
| 2.0711 |
2.0641 |
0.9718 |
4.3007 |
| H6 |
1.0984 |
2.1387 |
2.6098 |
3.1223 |
2.0711 |
| 1.7698 |
2.7011 |
3.5084 |
| H7 |
1.0990 |
2.1350 |
2.6509 |
3.0874 |
2.0641 |
1.7698 |
| 2.6837 |
3.5325 |
| H8 |
1.9358 |
2.2992 |
3.6289 |
2.1313 |
0.9718 |
2.7011 |
2.6837 |
| 4.1432 |
| H9 |
3.2273 |
1.8960 |
0.9729 |
2.3455 |
4.3007 |
3.5084 |
3.5325 |
4.1432 |
|
Maximum atom distance is 4.3007Å
between atoms O5 and H9.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
O3 |
112.408 |
|
C1 |
C2 |
O4 |
123.134 |
|
C2 |
C1 |
O5 |
111.020 |
|
O3 |
C2 |
O4 |
124.458 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
O5 |
H8 |
107.816 |
|
C2 |
C1 |
H6 |
108.465 |
|
C2 |
C1 |
H7 |
108.144 |
|
C2 |
O3 |
H9 |
108.630 |
|
O5 |
C1 |
H6 |
111.199 |
|
O5 |
C1 |
H7 |
110.580 |
|
H6 |
C1 |
H7 |
107.297 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.