|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COCH3 (Acetone)
1A1 C2V
1910171554
InChI=1S/C3H6O/c1-3(2)4/h1-2H3 INChIKey=CSCPPACGZOOCGX-UHFFFAOYSA-N
TPSSh/6-31+G**
Point group is C2
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.1809 |
|
0.1695 |
-0.0632 |
0.0000 |
| O2 |
0.0000 |
0.0000 |
1.4033 |
|
1.3149 |
-0.4902 |
0.0000 |
| C3 |
0.0000 |
1.2939 |
-0.6145 |
|
-0.1238 |
1.4271 |
0.0000 |
| C4 |
0.0000 |
-1.2939 |
-0.6145 |
|
-1.0278 |
-0.9978 |
0.0000 |
| H5 |
0.0232 |
2.1481 |
0.0631 |
|
0.8095 |
1.9908 |
0.0232 |
| H6 |
-0.0232 |
-2.1481 |
0.0631 |
|
-0.6912 |
-2.0349 |
-0.0232 |
| H7 |
0.8662 |
1.3281 |
-1.2857 |
|
-0.7408 |
1.6935 |
0.8662 |
| H8 |
-0.8947 |
1.3476 |
-1.2461 |
|
-0.6969 |
1.6980 |
-0.8947 |
| H9 |
-0.8662 |
-1.3281 |
-1.2857 |
|
-1.6686 |
-0.7953 |
-0.8662 |
| H10 |
0.8947 |
-1.3476 |
-1.2461 |
|
-1.6384 |
-0.8275 |
0.8947 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
|
1.2224 |
1.5188 |
1.5188 |
2.1515 |
2.1515 |
2.1598 |
2.1571 |
2.1598 |
2.1571 |
| O2 |
1.2224 |
| 2.3970 |
2.3970 |
2.5320 |
2.5320 |
3.1217 |
3.1042 |
3.1217 |
3.1042 |
| C3 |
1.5188 |
2.3970 |
| 2.5879 |
1.0906 |
3.5082 |
1.0963 |
1.0965 |
2.8418 |
2.8596 |
| C4 |
1.5188 |
2.3970 |
2.5879 |
| 3.5082 |
1.0906 |
2.8418 |
2.8596 |
1.0963 |
1.0965 |
| H5 |
2.1515 |
2.5320 |
1.0906 |
3.5082 |
| 4.2965 |
1.7895 |
1.7882 |
3.8333 |
3.8333 |
| H6 |
2.1515 |
2.5320 |
3.5082 |
1.0906 |
4.2965 |
| 3.8333 |
3.8333 |
1.7895 |
1.7882 |
| H7 |
2.1598 |
3.1217 |
1.0963 |
2.8418 |
1.7895 |
3.8333 |
| 1.7615 |
3.1711 |
2.6762 |
| H8 |
2.1571 |
3.1042 |
1.0965 |
2.8596 |
1.7882 |
3.8333 |
1.7615 |
| 2.6762 |
3.2352 |
| H9 |
2.1598 |
3.1217 |
2.8418 |
1.0963 |
3.8333 |
1.7895 |
3.1711 |
2.6762 |
| 1.7615 |
| H10 |
2.1571 |
3.1042 |
2.8596 |
1.0965 |
3.8333 |
1.7882 |
2.6762 |
3.2352 |
1.7615 |
|
Maximum atom distance is 4.2965Å
between atoms H5 and H6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
C1 |
C3 |
121.578 |
|
O2 |
C1 |
C4 |
121.578 |
|
C3 |
C1 |
C4 |
116.844 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H5 |
109.993 |
|
C1 |
C3 |
H7 |
110.311 |
|
C1 |
C3 |
H8 |
110.082 |
|
C1 |
C4 |
H6 |
109.993 |
|
C1 |
C4 |
H9 |
110.311 |
|
C1 |
C4 |
H10 |
110.082 |
|
H5 |
C3 |
H7 |
109.828 |
|
H5 |
C3 |
H8 |
109.690 |
|
H6 |
C4 |
H9 |
109.828 |
|
H6 |
C4 |
H10 |
109.690 |
|
H7 |
C3 |
H8 |
106.886 |
|
H9 |
C4 |
H10 |
106.886 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.