|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHF2CH2F (Ethane, 1,1,2-trifluoro)
1A C1
1910171554
InChI=1S/C2H3F3/c3-1-2(4)5/h2H,1H2 INChIKey=WGZYQOSEVSXDNI-UHFFFAOYSA-N
MP2/6-31+G**
Point group is C1
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.7614 |
-0.6036 |
-0.2880 |
|
0.7825 |
-0.5748 |
-0.2904 |
| C2 |
0.4618 |
0.0206 |
0.3357 |
|
-0.4671 |
-0.0005 |
0.3291 |
| F3 |
-1.8876 |
0.1004 |
0.1512 |
|
1.8815 |
0.1503 |
0.1822 |
| F4 |
1.5489 |
-0.7572 |
-0.0082 |
|
-1.5262 |
-0.8004 |
-0.0494 |
| F5 |
0.6646 |
1.2751 |
-0.1835 |
|
-0.6982 |
1.2597 |
-0.1638 |
| H6 |
-0.7008 |
-0.5312 |
-1.3720 |
|
0.7357 |
-0.4785 |
-1.3732 |
| H7 |
-0.8556 |
-1.6400 |
0.0300 |
|
0.9018 |
-1.6153 |
0.0048 |
| H8 |
0.4209 |
0.1046 |
1.4196 |
|
-0.4443 |
0.0590 |
1.4151 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
F3 |
F4 |
F5 |
H6 |
H7 |
H8 |
| C1 |
|
1.5083 |
1.3989 |
2.3322 |
2.3609 |
1.0881 |
1.0881 |
2.1944 |
| C2 |
1.5083 |
| 2.3580 |
1.3802 |
1.3727 |
2.1384 |
2.1417 |
1.0879 |
| F3 |
1.3989 |
2.3580 |
| 3.5454 |
2.8294 |
2.0317 |
2.0270 |
2.6340 |
| F4 |
2.3322 |
1.3802 |
3.5454 |
| 2.2232 |
2.6405 |
2.5616 |
2.0133 |
| F5 |
2.3609 |
1.3727 |
2.8294 |
2.2232 |
| 2.5573 |
3.2945 |
1.9998 |
| H6 |
1.0881 |
2.1384 |
2.0317 |
2.6405 |
2.5573 |
| 1.7941 |
3.0750 |
| H7 |
1.0881 |
2.1417 |
2.0270 |
2.5616 |
3.2945 |
1.7941 |
| 2.5699 |
| H8 |
2.1944 |
1.0879 |
2.6340 |
2.0133 |
1.9998 |
3.0750 |
2.5699 |
|
Maximum atom distance is 3.5454Å
between atoms F3 and F4.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
F4 |
107.604 |
|
C1 |
C2 |
F5 |
109.973 |
|
C2 |
C1 |
F3 |
108.346 |
|
F4 |
C2 |
F5 |
107.725 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H8 |
114.423 |
|
C2 |
C1 |
H6 |
109.835 |
|
C2 |
C1 |
H7 |
110.092 |
|
F3 |
C1 |
H6 |
108.913 |
|
F3 |
C1 |
H7 |
108.535 |
|
F4 |
C2 |
H8 |
108.748 |
|
F5 |
C2 |
H8 |
108.169 |
|
H6 |
C1 |
H7 |
111.059 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.