|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C3H8O2 (Propylene glycol)
1A C1
1910171554
InChI=1S/C3H8O2/c1-3(5)2-4/h3-5H,2H2,1H3 INChIKey=DNIAPMSPPWPWGF-UHFFFAOYSA-N
MP2=FULL/6-31+G**
Point group is C1
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| O1 |
-0.4543 |
1.3768 |
-0.1556 |
|
0.4103 |
1.3927 |
-0.1350 |
| H2 |
0.4686 |
1.6734 |
-0.1387 |
|
-0.5220 |
1.6587 |
-0.1234 |
| O3 |
1.9459 |
-0.0392 |
0.0082 |
|
-1.9436 |
-0.1029 |
-0.0106 |
| H4 |
2.2067 |
-0.2080 |
0.9227 |
|
-2.2069 |
-0.2912 |
0.8994 |
| C5 |
0.7105 |
-0.7235 |
-0.2468 |
|
-0.6841 |
-0.7433 |
-0.2620 |
| H6 |
0.6141 |
-0.7509 |
-1.3306 |
|
-0.5771 |
-0.7545 |
-1.3451 |
| H7 |
0.7398 |
-1.7472 |
0.1346 |
|
-0.6833 |
-1.7720 |
0.1070 |
| C8 |
-0.4592 |
0.0405 |
0.3447 |
|
0.4545 |
0.0513 |
0.3495 |
| H9 |
-0.3462 |
0.0580 |
1.4378 |
|
0.3311 |
0.0519 |
1.4415 |
| C10 |
-1.7916 |
-0.5762 |
-0.0177 |
|
1.8097 |
-0.5171 |
-0.0077 |
| H11 |
-1.9011 |
-0.6111 |
-1.1004 |
|
1.9300 |
-0.5352 |
-1.0896 |
| H12 |
-1.8728 |
-1.5864 |
0.3823 |
|
1.9203 |
-1.5288 |
0.3812 |
| H13 |
-2.5997 |
0.0263 |
0.3900 |
|
2.5938 |
0.1066 |
0.4147 |
Atom - Atom Distances (Å)
| |
O1 |
H2 |
O3 |
H4 |
C5 |
H6 |
H7 |
C8 |
H9 |
C10 |
H11 |
H12 |
H13 |
| O1 |
|
0.9695 |
2.7916 |
3.2795 |
2.4034 |
2.6551 |
3.3571 |
1.4269 |
2.0712 |
2.3710 |
2.6340 |
3.3290 |
2.5931 |
| H2 |
0.9695 |
| 2.2665 |
2.7726 |
2.4115 |
2.7054 |
3.4422 |
1.9393 |
2.3997 |
3.1912 |
3.4291 |
4.0472 |
3.5223 |
| O3 |
2.7916 |
2.2665 |
|
0.9658 |
1.4351 |
2.0181 |
2.0948 |
2.4299 |
2.7031 |
3.7760 |
4.0442 |
4.1372 |
4.5621 |
| H4 |
3.2795 |
2.7726 |
0.9658 |
| 1.9678 |
2.8122 |
2.2676 |
2.7391 |
2.6178 |
4.1239 |
4.5967 |
4.3398 |
4.8414 |
| C5 |
2.4034 |
2.4115 |
1.4351 |
1.9678 |
|
1.0884 |
1.0929 |
1.5172 |
2.1366 |
2.5169 |
2.7499 |
2.7953 |
3.4533 |
| H6 |
2.6551 |
2.7054 |
2.0181 |
2.8122 |
1.0884 |
| 1.7763 |
2.1413 |
3.0398 |
2.7462 |
2.5296 |
3.1331 |
3.7273 |
| H7 |
3.3571 |
3.4422 |
2.0948 |
2.2676 |
1.0929 |
1.7763 |
| 2.1628 |
2.4772 |
2.7933 |
3.1290 |
2.6293 |
3.7898 |
| C8 |
1.4269 |
1.9393 |
2.4299 |
2.7391 |
1.5172 |
2.1413 |
2.1628 |
|
1.0990 |
1.5123 |
2.1429 |
2.1555 |
2.1410 |
| H9 |
2.0712 |
2.3997 |
2.7031 |
2.6178 |
2.1366 |
3.0398 |
2.4772 |
1.0990 |
| 2.1471 |
3.0509 |
2.4797 |
2.4854 |
| C10 |
2.3710 |
3.1912 |
3.7760 |
4.1239 |
2.5169 |
2.7462 |
2.7933 |
1.5123 |
2.1471 |
|
1.0887 |
1.0895 |
1.0873 |
| H11 |
2.6340 |
3.4291 |
4.0442 |
4.5967 |
2.7499 |
2.5296 |
3.1290 |
2.1429 |
3.0509 |
1.0887 |
| 1.7749 |
1.7650 |
| H12 |
3.3290 |
4.0472 |
4.1372 |
4.3398 |
2.7953 |
3.1331 |
2.6293 |
2.1555 |
2.4797 |
1.0895 |
1.7749 |
| 1.7689 |
| H13 |
2.5931 |
3.5223 |
4.5621 |
4.8414 |
3.4533 |
3.7273 |
3.7898 |
2.1410 |
2.4854 |
1.0873 |
1.7650 |
1.7689 |
|
Maximum atom distance is 4.8414Å
between atoms H4 and H13.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O1 |
C8 |
C5 |
109.405 |
|
O1 |
C8 |
C10 |
107.512 |
|
O3 |
C5 |
C8 |
110.750 |
|
C5 |
C8 |
C10 |
112.364 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O1 |
C8 |
H9 |
109.478 |
|
H2 |
O1 |
C8 |
106.478 |
|
O3 |
C5 |
H6 |
105.379 |
|
O3 |
C5 |
H7 |
111.197 |
|
H4 |
O3 |
C5 |
108.499 |
|
C5 |
C8 |
H9 |
108.450 |
|
H6 |
C5 |
H7 |
109.044 |
|
H6 |
C5 |
C8 |
109.427 |
|
H7 |
C5 |
C8 |
110.874 |
|
C8 |
C10 |
H11 |
109.878 |
|
C8 |
C10 |
H12 |
110.839 |
|
C8 |
C10 |
H13 |
109.811 |
|
H9 |
C8 |
C10 |
109.603 |
|
H11 |
C10 |
H12 |
109.141 |
|
H11 |
C10 |
H13 |
108.415 |
|
H12 |
C10 |
H13 |
108.709 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.