|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CHClCH3 (Propane, 2-chloro-)
1A' CS
1910171554
InChI=1S/C3H7Cl/c1-3(2)4/h3H,1-2H3 INChIKey=ULYZAYCEDJDHCC-UHFFFAOYSA-N
MP3/6-31+G**
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| Cl1 |
-0.8829 |
1.0186 |
0.0000 |
|
-0.5551 |
-0.6866 |
1.0186 |
| C2 |
0.5652 |
-0.0655 |
0.0000 |
|
0.3553 |
0.4395 |
-0.0655 |
| C3 |
0.5652 |
-0.9030 |
1.2663 |
|
1.3400 |
-0.3566 |
-0.9030 |
| C4 |
0.5652 |
-0.9030 |
-1.2663 |
|
-0.6294 |
1.2356 |
-0.9030 |
| H5 |
1.4172 |
0.6095 |
0.0000 |
|
0.8910 |
1.1021 |
0.6095 |
| H6 |
1.4582 |
-1.5281 |
1.2855 |
|
1.9165 |
0.3257 |
-1.5281 |
| H7 |
1.4582 |
-1.5281 |
-1.2855 |
|
-0.0829 |
1.9422 |
-1.5281 |
| H8 |
0.5625 |
-0.2725 |
2.1517 |
|
2.0269 |
-0.9154 |
-0.2725 |
| H9 |
0.5625 |
-0.2725 |
-2.1517 |
|
-1.3197 |
1.7902 |
-0.2725 |
| H10 |
-0.3109 |
-1.5481 |
1.2951 |
|
0.8117 |
-1.0560 |
-1.5481 |
| H11 |
-0.3109 |
-1.5481 |
-1.2951 |
|
-1.2026 |
0.5725 |
-1.5481 |
Atom - Atom Distances (Å)
| |
Cl1 |
C2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
| Cl1 |
| 1.8089 |
2.7190 |
2.7190 |
2.3363 |
3.6904 |
3.6904 |
2.8959 |
2.8959 |
2.9313 |
2.9313 |
| C2 |
1.8089 |
|
1.5182 |
1.5182 |
1.0870 |
2.1423 |
2.1423 |
2.1617 |
2.1617 |
2.1547 |
2.1547 |
| C3 |
2.7190 |
1.5182 |
| 2.5326 |
2.1487 |
1.0902 |
2.7749 |
1.0870 |
3.4757 |
1.0883 |
2.7828 |
| C4 |
2.7190 |
1.5182 |
2.5326 |
| 2.1487 |
2.7749 |
1.0902 |
3.4757 |
1.0870 |
2.7828 |
1.0883 |
| H5 |
2.3363 |
1.0870 |
2.1487 |
2.1487 |
| 2.4947 |
2.4947 |
2.4776 |
2.4776 |
3.0526 |
3.0526 |
| H6 |
3.6904 |
2.1423 |
1.0902 |
2.7749 |
2.4947 |
| 2.5711 |
1.7689 |
3.7674 |
1.7692 |
3.1288 |
| H7 |
3.6904 |
2.1423 |
2.7749 |
1.0902 |
2.4947 |
2.5711 |
| 3.7674 |
1.7689 |
3.1288 |
1.7692 |
| H8 |
2.8959 |
2.1617 |
1.0870 |
3.4757 |
2.4776 |
1.7689 |
3.7674 |
| 4.3035 |
1.7673 |
3.7776 |
| H9 |
2.8959 |
2.1617 |
3.4757 |
1.0870 |
2.4776 |
3.7674 |
1.7689 |
4.3035 |
| 3.7776 |
1.7673 |
| H10 |
2.9313 |
2.1547 |
1.0883 |
2.7828 |
3.0526 |
1.7692 |
3.1288 |
1.7673 |
3.7776 |
| 2.5902 |
| H11 |
2.9313 |
2.1547 |
2.7828 |
1.0883 |
3.0526 |
3.1288 |
1.7692 |
3.7776 |
1.7673 |
2.5902 |
|
Maximum atom distance is 4.3035Å
between atoms H8 and H9.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
Cl1 |
C2 |
C3 |
109.306 |
|
Cl1 |
C2 |
C4 |
109.306 |
|
C3 |
C2 |
C4 |
113.036 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
Cl1 |
C3 |
H5 |
55.894 |
|
C2 |
C3 |
H6 |
109.331 |
|
C2 |
C3 |
H8 |
111.066 |
|
C2 |
C3 |
H10 |
110.431 |
|
C2 |
C4 |
H7 |
109.331 |
|
C2 |
C4 |
H9 |
111.066 |
|
C2 |
C4 |
H11 |
110.431 |
|
C3 |
C2 |
H5 |
110.032 |
|
C4 |
C2 |
H5 |
110.032 |
|
H6 |
C3 |
H8 |
108.674 |
|
H6 |
C3 |
H10 |
108.607 |
|
H7 |
C4 |
H9 |
108.674 |
|
H7 |
C4 |
H11 |
108.607 |
|
H8 |
C3 |
H10 |
108.677 |
|
H9 |
C4 |
H11 |
108.677 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.