|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COCCH (3-butyn-2-one)
1A' CS
1910171554
InChI=1S/C4H4O/c1-3-4(2)5/h1H,2H3 INChIKey=XRGPFNGLRSIPSA-UHFFFAOYSA-N
B97D3/6-31+G**
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
1.4958 |
0.7506 |
0.0000 |
|
0.1766 |
1.6642 |
0.0000 |
| C2 |
0.0000 |
0.4966 |
0.0000 |
|
0.4649 |
0.1747 |
0.0000 |
| O3 |
-0.8390 |
1.3942 |
0.0000 |
|
1.6002 |
-0.2950 |
0.0000 |
| C4 |
-0.4036 |
-0.9061 |
0.0000 |
|
-0.7063 |
-0.6965 |
0.0000 |
| C5 |
-0.7318 |
-2.0818 |
0.0000 |
|
-1.6915 |
-1.4172 |
0.0000 |
| H6 |
1.6870 |
1.8285 |
0.0000 |
|
1.1184 |
2.2223 |
0.0000 |
| H7 |
1.9542 |
0.2836 |
0.8838 |
|
-0.4218 |
1.9291 |
0.8838 |
| H8 |
1.9542 |
0.2836 |
-0.8838 |
|
-0.4218 |
1.9291 |
-0.8838 |
| H9 |
-1.0458 |
-3.1056 |
0.0000 |
|
-2.5394 |
-2.0712 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
O3 |
C4 |
C5 |
H6 |
H7 |
H8 |
H9 |
| C1 |
|
1.5172 |
2.4218 |
2.5204 |
3.6035 |
1.0947 |
1.0997 |
1.0997 |
4.6184 |
| C2 |
1.5172 |
|
1.2287 |
1.4596 |
2.6803 |
2.1494 |
2.1553 |
2.1553 |
3.7509 |
| O3 |
2.4218 |
1.2287 |
| 2.3412 |
3.4777 |
2.5630 |
3.1331 |
3.1331 |
4.5046 |
| C4 |
2.5204 |
1.4596 |
2.3412 |
|
1.2207 |
3.4422 |
2.7849 |
2.7849 |
2.2913 |
| C5 |
3.6035 |
2.6803 |
3.4777 |
1.2207 |
| 4.5980 |
3.6866 |
3.6866 |
1.0708 |
| H6 |
1.0947 |
2.1494 |
2.5630 |
3.4422 |
4.5980 |
| 1.7998 |
1.7998 |
5.6403 |
| H7 |
1.0997 |
2.1553 |
3.1331 |
2.7849 |
3.6866 |
1.7998 |
| 1.7675 |
4.6117 |
| H8 |
1.0997 |
2.1553 |
3.1331 |
2.7849 |
3.6866 |
1.7998 |
1.7675 |
| 4.6117 |
| H9 |
4.6184 |
3.7509 |
4.5046 |
2.2913 |
1.0708 |
5.6403 |
4.6117 |
4.6117 |
|
Maximum atom distance is 5.6403Å
between atoms H6 and H9.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
O3 |
123.426 |
|
C1 |
C2 |
C4 |
115.690 |
|
C2 |
C4 |
C5 |
179.548 |
|
O3 |
C2 |
C4 |
120.884 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
H6 |
109.697 |
|
C2 |
C1 |
H7 |
109.872 |
|
C2 |
C1 |
H8 |
109.872 |
|
C4 |
C5 |
H9 |
178.550 |
|
H6 |
C1 |
H7 |
110.202 |
|
H6 |
C1 |
H8 |
110.202 |
|
H7 |
C1 |
H8 |
106.959 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.