|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHBrCl2 (Methane, bromodichloro-)
1A' CS
1910171554
InChI=1S/CHBrCl2/c2-1(3)4/h1H INChIKey=FMWLUWPQPKEARP-UHFFFAOYSA-N
MP3/6-31+G**
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.6905 |
-0.1211 |
0.0000 |
|
0.3956 |
-0.5660 |
-0.1211 |
| H2 |
-1.5753 |
0.4969 |
0.0000 |
|
0.9024 |
-1.2912 |
0.4969 |
| Br3 |
0.8342 |
1.0936 |
0.0000 |
|
-0.4779 |
0.6837 |
1.0936 |
| Cl4 |
-0.6905 |
-1.1190 |
1.4539 |
|
1.5873 |
0.2669 |
-1.1190 |
| Cl5 |
-0.6905 |
-1.1190 |
-1.4539 |
|
-0.7961 |
-1.3989 |
-1.1190 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
Br3 |
Cl4 |
Cl5 |
| C1 |
|
1.0792 |
1.9494 |
1.7634 |
1.7634 |
| H2 |
1.0792 |
| 2.4823 |
2.3469 |
2.3469 |
| Br3 |
1.9494 |
2.4823 |
| 3.0552 |
3.0552 |
| Cl4 |
1.7634 |
2.3469 |
3.0552 |
| 2.9078 |
| Cl5 |
1.7634 |
2.3469 |
3.0552 |
2.9078 |
|
Maximum atom distance is 3.0552Å
between atoms Br3 and Cl4.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
Br3 |
C1 |
Cl4 |
110.648 |
|
Br3 |
C1 |
Cl5 |
110.648 |
|
Cl4 |
C1 |
Cl5 |
111.071 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
Br3 |
106.522 |
|
H2 |
C1 |
Cl4 |
108.907 |
|
H2 |
C1 |
Cl5 |
108.907 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.