|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CaCO3 (Calcium Carbonate)
1A1 C2V
1910171554
InChI=1S/CH2O3.Ca/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 INChIKey=VTYYLEPIZMXCLO-UHFFFAOYSA-L
wB97X-D/cc-pVDZ
Point group is C2v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
-1.0885 |
|
-1.0885 |
0.0000 |
0.0000 |
| O2 |
0.0000 |
0.0000 |
-2.3133 |
|
-2.3133 |
0.0000 |
0.0000 |
| Ca3 |
0.0000 |
0.0000 |
1.5165 |
|
1.5165 |
0.0000 |
0.0000 |
| O4 |
0.0000 |
1.1139 |
-0.3308 |
|
-0.3308 |
1.1139 |
0.0000 |
| O5 |
0.0000 |
-1.1139 |
-0.3308 |
|
-0.3308 |
-1.1139 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
Ca3 |
O4 |
O5 |
| C1 |
|
1.2249 |
2.6050 |
1.3472 |
1.3472 |
| O2 |
1.2249 |
| 3.8298 |
2.2741 |
2.2741 |
| Ca3 |
2.6050 |
3.8298 |
| 2.1571 |
2.1571 |
| O4 |
1.3472 |
2.2741 |
2.1571 |
| 2.2278 |
| O5 |
1.3472 |
2.2741 |
2.1571 |
2.2278 |
|
Maximum atom distance is 3.8298Å
between atoms O2 and Ca3.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
C1 |
Ca3 |
180.000 |
|
O2 |
C1 |
O4 |
124.225 |
|
O2 |
C1 |
O5 |
124.225 |
|
Ca3 |
C1 |
O4 |
55.775 |
|
Ca3 |
C1 |
O5 |
55.775 |
|
O4 |
C1 |
O5 |
111.549 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.