|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CHOHCH3 (Isopropyl alcohol)
1A C1
1910171554
InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3 INChIKey=KFZMGEQAYNKOFK-UHFFFAOYSA-N
B1B95/cc-pVDZ
Point group is C1
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0018 |
0.0424 |
0.3634 |
|
0.0058 |
0.0346 |
0.3642 |
| C2 |
-1.1956 |
-0.7687 |
-0.1029 |
|
1.0505 |
-0.9549 |
-0.1242 |
| C3 |
1.3175 |
-0.5546 |
-0.0887 |
|
-1.3917 |
-0.3252 |
-0.0935 |
| O4 |
-0.0367 |
1.3602 |
-0.1629 |
|
0.2628 |
1.3381 |
-0.1355 |
| H5 |
-0.0050 |
0.0785 |
1.4715 |
|
0.0201 |
0.0459 |
1.4727 |
| H6 |
-2.1381 |
-0.3103 |
0.2348 |
|
2.0567 |
-0.6672 |
0.2181 |
| H7 |
-1.2156 |
-0.8184 |
-1.2012 |
|
1.0603 |
-0.9845 |
-1.2234 |
| H8 |
-1.1667 |
-1.7935 |
0.2942 |
|
0.8516 |
-1.9687 |
0.2521 |
| H9 |
2.1536 |
0.0752 |
0.2424 |
|
-2.1105 |
0.4281 |
0.2543 |
| H10 |
1.4552 |
-1.5644 |
0.3206 |
|
-1.6953 |
-1.3063 |
0.2959 |
| H11 |
1.3482 |
-0.6130 |
-1.1863 |
|
-1.4332 |
-0.3548 |
-1.1919 |
| H12 |
-0.8804 |
1.7496 |
0.0965 |
|
1.1600 |
1.5759 |
0.1276 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
O4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
H12 |
| C1 |
|
1.5195 |
1.5139 |
1.4195 |
1.1087 |
2.1726 |
2.1613 |
2.1774 |
2.1554 |
2.1671 |
2.1550 |
1.9401 |
| C2 |
1.5195 |
| 2.5223 |
2.4246 |
2.1480 |
1.1011 |
1.0996 |
1.0995 |
3.4710 |
2.7999 |
2.7693 |
2.5457 |
| C3 |
1.5139 |
2.5223 |
| 2.3464 |
2.1411 |
3.4794 |
2.7792 |
2.8023 |
1.0978 |
1.0983 |
1.0996 |
3.1897 |
| O4 |
1.4195 |
2.4246 |
2.3464 |
| 2.0773 |
2.7138 |
2.6859 |
3.3811 |
2.5715 |
3.3186 |
2.6189 |
0.9647 |
| H5 |
1.1087 |
2.1480 |
2.1411 |
2.0773 |
| 2.4961 |
3.0681 |
2.4980 |
2.4840 |
2.4811 |
3.0616 |
2.3345 |
| H6 |
2.1726 |
1.1011 |
3.4794 |
2.7138 |
2.4961 |
| 1.7808 |
1.7740 |
4.3089 |
3.8069 |
3.7769 |
2.4175 |
| H7 |
2.1613 |
1.0996 |
2.7792 |
2.6859 |
3.0681 |
1.7808 |
| 1.7859 |
3.7727 |
3.1632 |
2.5720 |
2.8967 |
| H8 |
2.1774 |
1.0995 |
2.8023 |
3.3811 |
2.4980 |
1.7740 |
1.7859 |
| 3.8103 |
2.6321 |
3.1481 |
3.5602 |
| H9 |
2.1554 |
3.4710 |
1.0978 |
2.5715 |
2.4840 |
4.3089 |
3.7727 |
3.8103 |
| 1.7838 |
1.7786 |
3.4684 |
| H10 |
2.1671 |
2.7999 |
1.0983 |
3.3186 |
2.4811 |
3.8069 |
3.1632 |
2.6321 |
1.7838 |
| 1.7854 |
4.0606 |
| H11 |
2.1550 |
2.7693 |
1.0996 |
2.6189 |
3.0616 |
3.7769 |
2.5720 |
3.1481 |
1.7786 |
1.7854 |
| 3.4919 |
| H12 |
1.9401 |
2.5457 |
3.1897 |
0.9647 |
2.3345 |
2.4175 |
2.8967 |
3.5602 |
3.4684 |
4.0606 |
3.4919 |
|
Maximum atom distance is 4.3089Å
between atoms H6 and H9.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
C3 |
112.503 |
|
C2 |
C1 |
O4 |
111.123 |
|
C3 |
C1 |
O4 |
106.196 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H6 |
110.991 |
|
C1 |
C2 |
H7 |
110.179 |
|
C1 |
C2 |
H8 |
111.470 |
|
C1 |
C3 |
H9 |
110.218 |
|
C1 |
C3 |
H10 |
111.114 |
|
C1 |
C3 |
H11 |
110.074 |
|
C1 |
O4 |
H12 |
107.384 |
|
C2 |
C1 |
H5 |
108.613 |
|
C3 |
C1 |
H5 |
108.459 |
|
O4 |
C1 |
H5 |
109.890 |
|
H6 |
C2 |
H7 |
108.035 |
|
H6 |
C2 |
H8 |
107.443 |
|
H7 |
C2 |
H8 |
108.602 |
|
H9 |
C3 |
H10 |
108.636 |
|
H9 |
C3 |
H11 |
108.080 |
|
H10 |
C3 |
H11 |
108.645 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.